The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(2-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)-1H-1,2,3-triazol-4-yl)methoxy)-N-(p-tolyl)benzamide ID: ALA4074079
PubChem CID: 137641162
Max Phase: Preclinical
Molecular Formula: C30H33N5O4
Molecular Weight: 527.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCn1cc(COc3ccccc3C(=O)Nc3ccc(C)cc3)nn1)CC2
Standard InChI: InChI=1S/C30H33N5O4/c1-21-8-10-24(11-9-21)31-30(36)26-6-4-5-7-27(26)39-20-25-19-35(33-32-25)15-14-34-13-12-22-16-28(37-2)29(38-3)17-23(22)18-34/h4-11,16-17,19H,12-15,18,20H2,1-3H3,(H,31,36)
Standard InChI Key: VBZMWGPVWJHSCM-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
10.7624 -4.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7612 -5.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4734 -5.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1872 -5.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1844 -4.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4716 -4.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8997 -5.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9010 -6.6703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6068 -5.4393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3192 -5.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8947 -4.1993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6039 -4.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3142 -4.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0636 -4.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6122 -3.9172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1968 -3.2068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3941 -3.3799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4305 -3.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8387 -3.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6600 -3.2042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0698 -3.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8875 -3.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0679 -2.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8918 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2967 -3.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1169 -3.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5332 -2.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1192 -1.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3003 -1.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5324 -1.0811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3545 -2.5105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7611 -3.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3537 -1.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3159 -6.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0275 -7.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7397 -6.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7358 -5.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0236 -5.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4490 -7.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
5 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 23 1 0
21 22 1 0
22 25 1 0
24 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
27 31 1 0
31 32 1 0
30 33 1 0
10 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 10 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.63Molecular Weight (Monoisotopic): 527.2533AlogP: 4.49#Rotatable Bonds: 10Polar Surface Area: 90.74Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.14CX LogP: 4.74CX LogD: 4.55Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -1.54
References 1. Pan M, Cui J, Jiao L, Ghaleb H, Liao C, Zhou J, Kairuki M, Lin H, Huang W, Qian H.. (2017) Synthesis and biological evaluation of JL-A7 derivatives as potent ABCB1 inhibitors., 25 (15): [PMID:28645831 ] [10.1016/j.bmc.2017.06.015 ]