2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 4-nitrobenzoate

ID: ALA4074226

Cas Number: 13357-10-3

PubChem CID: 3114896

Max Phase: Preclinical

Molecular Formula: C13H12N4O6

Molecular Weight: 320.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C13H12N4O6/c1-9-14-8-12(17(21)22)15(9)6-7-23-13(18)10-2-4-11(5-3-10)16(19)20/h2-5,8H,6-7H2,1H3

Standard InChI Key:  SUOFRVXYTWIPIL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    4.2829  -18.9152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9374  -18.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6760  -17.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8564  -17.6623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6175  -18.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2931  -19.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7198  -18.6685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3202  -18.1141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8997  -19.4656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0058  -20.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0159  -20.9493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7286  -21.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7388  -22.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4312  -20.9317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8440  -18.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0354  -22.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0452  -23.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7584  -23.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4633  -23.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4501  -22.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7724  -24.6166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4856  -25.0155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0704  -25.0349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 21 22  2  0
 21 23  1  0
 18 21  1  0
M  CHG  4   7   1   9  -1  21   1  23  -1
M  END

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 320.26Molecular Weight (Monoisotopic): 320.0757AlogP: 1.86#Rotatable Bonds: 6
Polar Surface Area: 130.40Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 1.98CX LogD: 1.98
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.45Np Likeness Score: -1.48

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source