{5-Methyl-2-[({6-[4-(trifluoromethyl)phenoxy]pyridin-3-yl}carbonyl)amino]phenyl}boronic acid

ID: ALA4074445

PubChem CID: 137641307

Max Phase: Preclinical

Molecular Formula: C20H16BF3N2O4

Molecular Weight: 416.16

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)c2ccc(Oc3ccc(C(F)(F)F)cc3)nc2)c(B(O)O)c1

Standard InChI:  InChI=1S/C20H16BF3N2O4/c1-12-2-8-17(16(10-12)21(28)29)26-19(27)13-3-9-18(25-11-13)30-15-6-4-14(5-7-15)20(22,23)24/h2-11,28-29H,1H3,(H,26,27)

Standard InChI Key:  JIRMJKOVENECRF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   15.5575  -11.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8441  -10.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8517   -9.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1454   -9.3900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4355   -9.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4320  -10.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1363  -11.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4069   -9.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6968   -9.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6911  -10.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9794  -11.0468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2693  -10.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2784   -9.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9901   -9.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4084   -8.5987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1094   -9.8281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8232   -9.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5292   -9.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2430   -9.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2486   -8.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5405   -8.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8268   -8.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5221  -10.6486    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   12.7293   -9.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7323   -8.5685    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.0201   -9.7917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.0185   -8.9767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8109  -11.0510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2263  -11.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9586   -8.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  2  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
  8 15  2  0
  8 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 18 23  1  0
 16 17  1  0
 12  1  1  0
  5 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 23 28  1  0
 23 29  1  0
 20 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4074445

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.16Molecular Weight (Monoisotopic): 416.1155AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ogiyama T, Yamaguchi M, Kurikawa N, Honzumi S, Yamamoto Y, Sugiyama D, Takakusa H, Inoue SI..  (2017)  Identification of a novel hormone sensitive lipase inhibitor with a reduced potential of reactive metabolites formation.,  25  (7): [PMID:28279560] [10.1016/j.bmc.2017.02.045]

Source