(+)-(2R)-1,2-Dibenzyl-4-(2-phenylethyl)-1,4-diazepane

ID: ALA4075270

PubChem CID: 137649011

Max Phase: Preclinical

Molecular Formula: C27H32N2

Molecular Weight: 384.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(CCN2CCCN(Cc3ccccc3)[C@H](Cc3ccccc3)C2)cc1

Standard InChI:  InChI=1S/C27H32N2/c1-4-11-24(12-5-1)17-20-28-18-10-19-29(22-26-15-8-3-9-16-26)27(23-28)21-25-13-6-2-7-14-25/h1-9,11-16,27H,10,17-23H2/t27-/m1/s1

Standard InChI Key:  ZPFKAULIVVXNSX-HHHXNRCGSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   10.4774  -10.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2190   -9.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9575  -10.0802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2823  -10.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1342  -10.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7905  -11.5104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6128  -11.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9639  -12.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7820  -12.2579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1892  -12.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0066  -12.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4165  -12.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9990  -11.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1830  -11.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4300  -12.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6123  -12.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2110  -11.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3940  -11.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9787  -12.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3863  -12.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2019  -12.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6002   -9.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3587   -9.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0014   -9.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7572   -9.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3995   -9.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2841   -8.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5207   -8.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8816   -8.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  6  1  0
  5  7  1  0
  6  7  1  0
  7  8  1  1
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  6 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  3 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4075270

    ---

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ERG2 C-8 sterol isomerase (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 384.57Molecular Weight (Monoisotopic): 384.2565AlogP: 5.05#Rotatable Bonds: 7
Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.88CX LogP: 5.91CX LogD: 3.46
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -0.76

References

1. Fanter L, Müller C, Schepmann D, Bracher F, Wünsch B..  (2017)  Chiral-pool synthesis of 1,2,4-trisubstituted 1,4-diazepanes as novel σ1 receptor ligands.,  25  (17): [PMID:28764962] [10.1016/j.bmc.2017.07.027]

Source