3'-Deoxy-3'-[4-(2-fluorophenyl)-1H-1,2,3-triazol-1-yl]-beta-D-galactopyranosyl-1-thio-beta-D-glucopyranoside

ID: ALA4075335

PubChem CID: 137651606

Max Phase: Preclinical

Molecular Formula: C20H26FN3O9S2

Molecular Weight: 535.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC[C@H]1O[C@@H](SS[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4ccccc4F)nn3)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C20H26FN3O9S2/c21-9-4-2-1-3-8(9)10-5-24(23-22-10)13-14(27)11(6-25)32-19(16(13)29)34-35-20-18(31)17(30)15(28)12(7-26)33-20/h1-5,11-20,25-31H,6-7H2/t11-,12-,13+,14+,15+,16-,17+,18-,19+,20+/m1/s1

Standard InChI Key:  BMNUPMIMBQHJNT-UYIOFKAJSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   43.5644  -20.8885    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.4733  -21.4027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.7497  -20.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.9685  -18.8894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.0236  -19.5749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.9185  -20.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1606  -20.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5077  -20.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6198  -19.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3777  -19.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4844  -18.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8360  -17.7680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.9318  -26.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2958  -27.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1119  -27.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5649  -26.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1960  -26.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3810  -26.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5551  -21.7056    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.5363  -23.3448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1066  -24.1482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6997  -23.3124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1347  -21.6893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8444  -22.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8350  -22.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1159  -23.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4147  -22.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4241  -22.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7185  -21.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4385  -24.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6829  -25.4054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5026  -25.4147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7646  -24.6380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0072  -22.0753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0149  -25.2869    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 10  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  1
  6  1  1  1
  7  2  1  6
  8  3  1  1
  9  4  1  1
 11 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 28 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  1
 24 19  1  1
 25 20  1  6
 26 21  1  1
 27 22  1  1
 21 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 21  1  0
 31 17  1  0
 29 34  1  0
 19  1  1  0
 18 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4075335

    ---

Associated Targets(Human)

LGALS3 Tchem Galectin-3 (545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.57Molecular Weight (Monoisotopic): 535.1094AlogP: -1.75#Rotatable Bonds: 7
Polar Surface Area: 190.78Molecular Species: NEUTRALHBA: 14HBD: 7
#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.28CX Basic pKa: CX LogP: -1.07CX LogD: -1.07
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.20Np Likeness Score: -0.18

References

1. Peterson K, Kumar R, Stenström O, Verma P, Verma PR, Håkansson M, Kahl-Knutsson B, Zetterberg F, Leffler H, Akke M, Logan DT, Nilsson UJ..  (2018)  Systematic Tuning of Fluoro-galectin-3 Interactions Provides Thiodigalactoside Derivatives with Single-Digit nM Affinity and High Selectivity.,  61  (3): [PMID:29284090] [10.1021/acs.jmedchem.7b01626]

Source