The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3'-Deoxy-3'-[4-(2-fluorophenyl)-1H-1,2,3-triazol-1-yl]-beta-D-galactopyranosyl-1-thio-beta-D-glucopyranoside ID: ALA4075335
PubChem CID: 137651606
Max Phase: Preclinical
Molecular Formula: C20H26FN3O9S2
Molecular Weight: 535.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@H]1O[C@@H](SS[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4ccccc4F)nn3)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C20H26FN3O9S2/c21-9-4-2-1-3-8(9)10-5-24(23-22-10)13-14(27)11(6-25)32-19(16(13)29)34-35-20-18(31)17(30)15(28)12(7-26)33-20/h1-5,11-20,25-31H,6-7H2/t11-,12-,13+,14+,15+,16-,17+,18-,19+,20+/m1/s1
Standard InChI Key: BMNUPMIMBQHJNT-UYIOFKAJSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
43.5644 -20.8885 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.4733 -21.4027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.7497 -20.5112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9685 -18.8894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0236 -19.5749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9185 -20.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1606 -20.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5077 -20.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6198 -19.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3777 -19.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4844 -18.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8360 -17.7680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9318 -26.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2958 -27.4318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1119 -27.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5649 -26.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1960 -26.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3810 -26.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5551 -21.7056 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.5363 -23.3448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1066 -24.1482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.6997 -23.3124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1347 -21.6893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8444 -22.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8350 -22.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1159 -23.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4147 -22.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4241 -22.0890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7185 -21.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4385 -24.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6829 -25.4054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5026 -25.4147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7646 -24.6380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0072 -22.0753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0149 -25.2869 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 1
6 1 1 1
7 2 1 6
8 3 1 1
9 4 1 1
11 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
28 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 1
24 19 1 1
25 20 1 6
26 21 1 1
27 22 1 1
21 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 21 1 0
31 17 1 0
29 34 1 0
19 1 1 0
18 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.57Molecular Weight (Monoisotopic): 535.1094AlogP: -1.75#Rotatable Bonds: 7Polar Surface Area: 190.78Molecular Species: NEUTRALHBA: 14HBD: 7#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.28CX Basic pKa: ┄CX LogP: -1.07CX LogD: -1.07Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.20Np Likeness Score: -0.18
References 1. Peterson K, Kumar R, Stenström O, Verma P, Verma PR, Håkansson M, Kahl-Knutsson B, Zetterberg F, Leffler H, Akke M, Logan DT, Nilsson UJ.. (2018) Systematic Tuning of Fluoro-galectin-3 Interactions Provides Thiodigalactoside Derivatives with Single-Digit nM Affinity and High Selectivity., 61 (3): [PMID:29284090 ] [10.1021/acs.jmedchem.7b01626 ]