2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 3-methylbenzoate

ID: ALA4075884

PubChem CID: 133716045

Max Phase: Preclinical

Molecular Formula: C14H15N3O4

Molecular Weight: 289.29

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C(=O)OCCn2c([N+](=O)[O-])cnc2C)c1

Standard InChI:  InChI=1S/C14H15N3O4/c1-10-4-3-5-12(8-10)14(18)21-7-6-16-11(2)15-9-13(16)17(19)20/h3-5,8-9H,6-7H2,1-2H3

Standard InChI Key:  ZMGNSXCKGSNWJT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    4.2664  -10.1077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9209   -9.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6595   -8.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8399   -8.8548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6010   -9.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2766  -10.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7033   -9.8610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3037   -9.3066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8832  -10.6581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9893  -11.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9994  -12.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7121  -12.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7222  -13.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4147  -12.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8274   -9.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0189  -13.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0287  -14.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7419  -14.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4468  -14.5663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4336  -13.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1609  -14.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 19 21  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4075884

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 289.29Molecular Weight (Monoisotopic): 289.1063AlogP: 2.27#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.48Np Likeness Score: -1.73

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source