N-((5'-methoxy-2'-oxospiro[bicyclo[2.2.1]heptane-2,3'-indoline]-3-yl)methyl)acetamide

ID: ALA4076015

PubChem CID: 137651399

Max Phase: Preclinical

Molecular Formula: C18H22N2O3

Molecular Weight: 314.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)C1(C(=O)N2)C2CCC(C2)C1CNC(C)=O

Standard InChI:  InChI=1S/C18H22N2O3/c1-10(21)19-9-15-11-3-4-12(7-11)18(15)14-8-13(23-2)5-6-16(14)20-17(18)22/h5-6,8,11-12,15H,3-4,7,9H2,1-2H3,(H,19,21)(H,20,22)

Standard InChI Key:  QHWUCVFOOKJRNN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
    4.1581  -13.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8705  -13.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8660  -12.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1505  -12.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4381  -12.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4411  -13.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3542  -13.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1622  -15.0157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6497  -14.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3748  -14.7658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6498  -13.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6582  -15.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9457  -13.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9374  -14.7658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4746  -14.3247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2364  -13.5198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5212  -13.9309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5873  -13.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2993  -13.2454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0161  -13.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7282  -13.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0206  -14.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2331  -13.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  0
  7 10  1  0
  9  8  1  0
  1  9  1  0
 10  8  1  0
 11  7  2  0
 12 10  2  0
 13 14  2  0
 14 12  1  0
 11 13  1  0
  9 15  2  0
 16 17  1  0
 13 16  1  0
  2 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
  6 23  1  0
 23  3  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4076015

    ---

Associated Targets(Human)

NQO2 Tchem Quinone reductase 2 (885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Oryctolagus cuniculus (11301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.39Molecular Weight (Monoisotopic): 314.1630AlogP: 2.07#Rotatable Bonds: 3
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: CX LogP: 1.19CX LogD: 1.19
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.90Np Likeness Score: 0.51

References

1. Zaryanova EV, Lozinskaya NA, Beznos OV, Volkova MS, Chesnokova NB, Zefirov NS..  (2017)  Oxindole-based intraocular pressure reducing agents.,  27  (16): [PMID:28687205] [10.1016/j.bmcl.2017.06.065]

Source