The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(2-(2-(2,6-dioxopiperazin-1-yl)ethoxy)ethoxy)ethyl)piperazine-2,6-dione ID: ALA4076601
PubChem CID: 137652093
Max Phase: Preclinical
Molecular Formula: C14H22N4O6
Molecular Weight: 342.35
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CNCC(=O)N1CCOCCOCCN1C(=O)CNCC1=O
Standard InChI: InChI=1S/C14H22N4O6/c19-11-7-15-8-12(20)17(11)1-3-23-5-6-24-4-2-18-13(21)9-16-10-14(18)22/h15-16H,1-10H2
Standard InChI Key: JWPIIWHYQJVNSG-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
2.7770 -8.3788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5942 -8.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0028 -9.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8200 -9.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2286 -8.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0458 -8.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4544 -9.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2716 -9.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6802 -8.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4973 -8.3789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9011 -9.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7147 -9.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1271 -8.3858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7197 -7.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8999 -7.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3694 -7.6702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5557 -7.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1433 -8.3741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5507 -9.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3705 -9.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7784 -9.7953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7794 -6.9633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4891 -9.7955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4910 -6.9652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
1 16 1 0
1 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
16 22 2 0
11 23 2 0
15 24 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 342.35Molecular Weight (Monoisotopic): 342.1539AlogP: -3.06#Rotatable Bonds: 9Polar Surface Area: 117.28Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.59CX LogP: -3.48CX LogD: -3.48Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.33Np Likeness Score: -0.62
References 1. Kumar A, Banerjee S, Roy P, Sondhi SM, Sharma A.. (2017) Solvent free, catalyst free, microwave or grinding assisted synthesis of bis-cyclic imide derivatives and their evaluation for anticancer activity., 27 (3): [PMID:28011220 ] [10.1016/j.bmcl.2016.12.031 ]