The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-fluoro-3-(2-morpholinopyrimidin-5-yl)phenyl]methyl-N-carbamimidoylcarbamate hydrochloride ID: ALA4077021
PubChem CID: 89600723
Max Phase: Preclinical
Molecular Formula: C17H20ClFN6O3
Molecular Weight: 374.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.N=C(N)NC(=O)OCc1cccc(-c2cnc(N3CCOCC3)nc2)c1F
Standard InChI: InChI=1S/C17H19FN6O3.ClH/c18-14-11(10-27-17(25)23-15(19)20)2-1-3-13(14)12-8-21-16(22-9-12)24-4-6-26-7-5-24;/h1-3,8-9H,4-7,10H2,(H4,19,20,23,25);1H
Standard InChI Key: AJIQJXLVMAPAKX-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
10.8031 -10.7341 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8215 -8.6211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1068 -9.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3961 -8.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6813 -9.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9664 -8.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9664 -7.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6813 -7.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3961 -7.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8262 -9.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8262 -9.0330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5410 -8.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2559 -9.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2559 -9.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5410 -10.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1155 -10.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1155 -11.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4007 -11.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6859 -11.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6859 -10.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4007 -9.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5346 -9.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2484 -8.6223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5339 -9.8574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9614 -9.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6752 -8.6235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9607 -9.8586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6813 -9.8568 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
2 3 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 21 1 0
10 16 1 0
6 13 1 0
2 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
25 27 2 0
5 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.38Molecular Weight (Monoisotopic): 374.1503AlogP: 1.24#Rotatable Bonds: 4Polar Surface Area: 126.45Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.46CX Basic pKa: 7.87CX LogP: 1.47CX LogD: 0.88Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.54Np Likeness Score: -1.26
References 1. Yamaki S, Yamada H, Nagashima A, Kondo M, Shimada Y, Kadono K, Yoshihara K.. (2017) Synthesis and structure activity relationships of carbamimidoylcarbamate derivatives as novel vascular adhesion protein-1 inhibitors., 25 (21): [PMID:28988626 ] [10.1016/j.bmc.2017.09.036 ]