The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-ethoxyphenylsulfonamido)-1-(4-ethoxyphenylsulfonyl)-N-hydroxy-2-methyl-1H-benzo[g]indole-3-carboxamide ID: ALA4077198
PubChem CID: 137650952
Max Phase: Preclinical
Molecular Formula: C30H29N3O8S2
Molecular Weight: 623.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(S(=O)(=O)Nc2cc3c(C(=O)NO)c(C)n(S(=O)(=O)c4ccc(OCC)cc4)c3c3ccccc23)cc1
Standard InChI: InChI=1S/C30H29N3O8S2/c1-4-40-20-10-14-22(15-11-20)42(36,37)32-27-18-26-28(30(34)31-35)19(3)33(29(26)25-9-7-6-8-24(25)27)43(38,39)23-16-12-21(13-17-23)41-5-2/h6-18,32,35H,4-5H2,1-3H3,(H,31,34)
Standard InChI Key: KBWJOQJHXVYEPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
1.8449 -8.5310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6373 -8.3205 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.0588 -7.7395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5317 -4.0488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7145 -4.0488 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.1231 -4.7565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8983 -5.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8972 -6.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6052 -6.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6034 -5.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3121 -5.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3128 -6.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7249 -5.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0158 -5.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7296 -6.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0197 -6.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1878 -7.7157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0017 -7.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3364 -7.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0114 -4.4645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7126 -3.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4222 -2.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4183 -2.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7079 -1.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0000 -2.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0075 -2.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7035 -0.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9931 -0.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2882 -0.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4085 -8.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1362 -6.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6815 -7.4972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3907 -6.1120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4812 -7.3293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8900 -9.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3402 -9.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5902 -10.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3898 -10.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9391 -10.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6862 -9.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6402 -11.4280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4393 -11.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6909 -12.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
12 16 1 0
15 13 1 0
13 14 2 0
14 11 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
14 20 1 0
20 5 1 0
5 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 1 0
24 27 1 0
28 29 1 0
18 30 1 0
19 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
17 2 1 0
2 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
41 42 1 0
38 41 1 0
42 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 623.71Molecular Weight (Monoisotopic): 623.1396AlogP: 5.06#Rotatable Bonds: 10Polar Surface Area: 153.03Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.65CX Basic pKa: ┄CX LogP: 3.92CX LogD: 3.75Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.14Np Likeness Score: -1.01
References 1. Yasuda D, Yuasa A, Obata R, Nakajima M, Takahashi K, Ohe T, Ichimura Y, Komatsu M, Yamamoto M, Imamura R, Kojima H, Okabe T, Nagano T, Mashino T.. (2017) Discovery of benzo[g]indoles as a novel class of non-covalent Keap1-Nrf2 protein-protein interaction inhibitor., 27 (22): [PMID:29037947 ] [10.1016/j.bmcl.2017.10.008 ] 2. Tran KT, Pallesen JS, Solbak SMØ, Narayanan D, Baig A, Zang J, Aguayo-Orozco A, Carmona RMC, Garcia AD, Bach A.. (2019) A Comparative Assessment Study of Known Small-Molecule Keap1-Nrf2 Protein-Protein Interaction Inhibitors: Chemical Synthesis, Binding Properties, and Cellular Activity., 62 (17): [PMID:31411465 ] [10.1021/acs.jmedchem.9b00723 ]