(E)-3-(4-(benzyloxy)benzylidene)-6-((3-(diethylamino)propyl)amino)-7-fluoro-2,3-dihydropyrrolo[2,1-b]quinazolin-9(1H)-one

ID: ALA4077352

PubChem CID: 137650252

Max Phase: Preclinical

Molecular Formula: C32H35FN4O2

Molecular Weight: 526.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNc1cc2nc3n(c(=O)c2cc1F)CC/C3=C\c1ccc(OCc2ccccc2)cc1

Standard InChI:  InChI=1S/C32H35FN4O2/c1-3-36(4-2)17-8-16-34-30-21-29-27(20-28(30)33)32(38)37-18-15-25(31(37)35-29)19-23-11-13-26(14-12-23)39-22-24-9-6-5-7-10-24/h5-7,9-14,19-21,34H,3-4,8,15-18,22H2,1-2H3/b25-19+

Standard InChI Key:  UCJVLBDAUNPSKQ-NCELDCMTSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   10.1708   -6.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4221   -7.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2184   -7.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4703   -8.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2698   -8.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8157   -7.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5659   -6.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7699   -6.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5650   -5.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5639   -6.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2760   -6.4370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2742   -4.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9787   -5.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9817   -6.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6838   -6.4346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6861   -4.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6861   -3.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8517   -6.4444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1361   -6.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4322   -6.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3950   -5.2116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3975   -6.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6513   -5.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1734   -4.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8500   -4.8024    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7220   -6.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0168   -6.4560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3066   -6.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0218   -7.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3016   -5.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7320   -7.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6144   -7.7533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8642   -8.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3152   -9.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5193   -8.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9706   -9.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2202  -10.3446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0236  -10.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5689   -9.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 14  2  0
 13 12  2  0
 12  9  1  0
 13 14  1  0
 13 16  1  0
 14 15  1  0
 15 22  2  0
 21 16  1  0
 16 17  2  0
 10 18  1  0
 18 19  1  0
 19 20  1  0
 21 22  1  0
 22  1  1  0
  1 23  1  0
 23 24  1  0
 24 21  1  0
  9 25  1  0
 20 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 28 30  1  0
 29 31  1  0
  6 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4077352

    ---

Associated Targets(Human)

NME2 Tbio Nucleoside diphosphate kinase 2 (168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.66Molecular Weight (Monoisotopic): 526.2744AlogP: 6.20#Rotatable Bonds: 11
Polar Surface Area: 59.39Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.94CX LogP: 5.25CX LogD: 2.76
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -1.08

References

1. Wang YQ, Huang ZL, Chen SB, Wang CX, Shan C, Yin QK, Ou TM, Li D, Gu LQ, Tan JH, Huang ZS..  (2017)  Design, Synthesis, and Evaluation of New Selective NM23-H2 Binders as c-MYC Transcription Inhibitors via Disruption of the NM23-H2/G-Quadruplex Interaction.,  60  (16): [PMID:28714689] [10.1021/acs.jmedchem.7b00421]

Source