(7-Acetamido-2-oxindole-3-yl)acetonitrile

ID: ALA4077467

PubChem CID: 137651458

Max Phase: Preclinical

Molecular Formula: C12H11N3O2

Molecular Weight: 229.24

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1cccc2c1NC(=O)C2CC#N

Standard InChI:  InChI=1S/C12H11N3O2/c1-7(16)14-10-4-2-3-8-9(5-6-13)12(17)15-11(8)10/h2-4,9H,5H2,1H3,(H,14,16)(H,15,17)

Standard InChI Key:  YFXWYXQIHLXYNX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 17 18  0  0  0  0  0  0  0  0999 V2000
   13.4776   -7.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6781   -8.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2813   -7.7947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3799  -10.1953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8731   -9.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6900   -9.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4065   -8.8734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6254   -9.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9257   -8.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2077   -9.0771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1935   -9.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8890  -10.3173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6070   -9.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1567  -11.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1383  -12.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4571  -11.1046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8747  -11.1342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  3  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  4 13  1  0
  8 13  2  0
  2  7  1  0
 14 15  1  0
 14 16  2  0
 14 17  1  0
 12 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4077467

    ---

Associated Targets(non-human)

Oryctolagus cuniculus (11301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 229.24Molecular Weight (Monoisotopic): 229.0851AlogP: 1.59#Rotatable Bonds: 2
Polar Surface Area: 81.99Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.56CX Basic pKa: CX LogP: 0.04CX LogD: 0.03
Aromatic Rings: 1Heavy Atoms: 17QED Weighted: 0.81Np Likeness Score: -0.42

References

1. Zaryanova EV, Lozinskaya NA, Beznos OV, Volkova MS, Chesnokova NB, Zefirov NS..  (2017)  Oxindole-based intraocular pressure reducing agents.,  27  (16): [PMID:28687205] [10.1016/j.bmcl.2017.06.065]

Source