(5-Acetamido-2-oxindole-3-yl)aceticacid

ID: ALA4077548

PubChem CID: 137651217

Max Phase: Preclinical

Molecular Formula: C12H12N2O4

Molecular Weight: 248.24

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc2c(c1)C(CC(=O)O)C(=O)N2

Standard InChI:  InChI=1S/C12H12N2O4/c1-6(15)13-7-2-3-10-8(4-7)9(5-11(16)17)12(18)14-10/h2-4,9H,5H2,1H3,(H,13,15)(H,14,18)(H,16,17)

Standard InChI Key:  QTPWUYQQXFCEQI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   14.2282   -9.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4298   -9.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8066   -9.6286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4829   -8.2730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1752  -11.3206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6594  -10.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4766  -10.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1752   -9.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4021  -10.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6930   -9.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9839  -10.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9839  -11.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6930  -11.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4021  -11.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5698  -10.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8607   -9.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5698  -11.0660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2748   -9.8402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  5 14  1  0
  9 14  2  0
  2  8  1  0
 15 16  1  0
 15 17  2  0
 15 18  1  0
 11 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4077548

    ---

Associated Targets(non-human)

Oryctolagus cuniculus (11301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 248.24Molecular Weight (Monoisotopic): 248.0797AlogP: 1.16#Rotatable Bonds: 3
Polar Surface Area: 95.50Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.87CX Basic pKa: CX LogP: -0.02CX LogD: -3.25
Aromatic Rings: 1Heavy Atoms: 18QED Weighted: 0.75Np Likeness Score: -0.43

References

1. Zaryanova EV, Lozinskaya NA, Beznos OV, Volkova MS, Chesnokova NB, Zefirov NS..  (2017)  Oxindole-based intraocular pressure reducing agents.,  27  (16): [PMID:28687205] [10.1016/j.bmcl.2017.06.065]

Source