The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(4-Ethylphenylamino)benzo[d]oxazol-5-yl)-3-(chloromethyl)benzamide ID: ALA4077563
PubChem CID: 54765632
Max Phase: Preclinical
Molecular Formula: C23H20ClN3O2
Molecular Weight: 405.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Nc2nc3cc(NC(=O)c4cccc(CCl)c4)ccc3o2)cc1
Standard InChI: InChI=1S/C23H20ClN3O2/c1-2-15-6-8-18(9-7-15)26-23-27-20-13-19(10-11-21(20)29-23)25-22(28)17-5-3-4-16(12-17)14-24/h3-13H,2,14H2,1H3,(H,25,28)(H,26,27)
Standard InChI Key: CSZBIDMQTBGDDO-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
27.9440 -13.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9429 -14.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6509 -14.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6492 -12.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3578 -13.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3626 -14.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1426 -14.3201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6200 -13.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1349 -12.9956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4371 -13.6501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8416 -12.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6586 -12.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0630 -12.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6502 -11.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8288 -11.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4281 -12.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0536 -10.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6400 -10.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2362 -12.8482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2360 -12.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5282 -11.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9437 -11.6222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5333 -10.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8264 -10.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1178 -10.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1206 -11.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8281 -12.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4144 -12.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7052 -11.6318 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
1 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
26 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.89Molecular Weight (Monoisotopic): 405.1244AlogP: 6.12#Rotatable Bonds: 6Polar Surface Area: 67.16Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.30CX Basic pKa: ┄CX LogP: 6.08CX LogD: 6.08Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: -1.54
References 1. Kim D, Won HY, Hwang ES, Kim YK, Choo HP.. (2017) Synthesis of benzoxazole derivatives as interleukin-6 antagonists., 25 (12): [PMID:28442260 ] [10.1016/j.bmc.2017.03.072 ]