2-([3,4'-Bipyridine]-2'-carbonyl)-N-(4-(pyrrolidin-1-ylmethyl)phenyl)hydrazinecarboxamide

ID: ALA4077671

PubChem CID: 137648889

Max Phase: Preclinical

Molecular Formula: C23H24N6O2

Molecular Weight: 416.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NNC(=O)c1cc(-c2cccnc2)ccn1)Nc1ccc(CN2CCCC2)cc1

Standard InChI:  InChI=1S/C23H24N6O2/c30-22(21-14-18(9-11-25-21)19-4-3-10-24-15-19)27-28-23(31)26-20-7-5-17(6-8-20)16-29-12-1-2-13-29/h3-11,14-15H,1-2,12-13,16H2,(H,27,30)(H2,26,28,31)

Standard InChI Key:  XAXNNIRMCJGHQI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    4.1726   -8.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8803   -7.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5880   -8.2586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8803   -7.0328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2958   -7.8500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2958   -7.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0035   -6.6242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5880   -6.6242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7112   -7.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7069   -7.8511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4138   -8.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1225   -7.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1198   -7.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4124   -6.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8307   -8.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8318   -9.0758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1747   -9.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4283  -10.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2455  -10.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4969   -9.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4654   -7.8471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7581   -8.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7577   -9.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4704   -9.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1747   -9.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4733  -10.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7646  -10.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7672  -11.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4768  -11.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1854  -11.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1794  -10.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
  1 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25  1  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4077671

    ---

Associated Targets(non-human)

Plasma (6361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.49Molecular Weight (Monoisotopic): 416.1961AlogP: 3.21#Rotatable Bonds: 5
Polar Surface Area: 99.25Molecular Species: ZWITTERIONHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.45CX Basic pKa: 9.13CX LogP: 0.79CX LogD: 0.73
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.85

References

1. Sandoval E, Lafuente-Monasterio MJ, Almela MJ, Castañeda P, Jiménez Díaz MB, Martínez-Martínez MS, Vidal J, Angulo-Barturen Í, Bamborough P, Burrows J, Cammack N, Chaparro MJ, Coterón JM, de Cozar C, Crespo B, Díaz B, Drewes G, Fernández E, Ferrer-Bazaga S, Fraile MT, Gamo FJ, Ghidelli-Disse S, Gómez R, Haselden J, Huss S, León ML, de Mercado J, Macdonald SJF, Martín Hernando JI, Prats S, Puente M, Rodríguez A, de la Rosa JC, Rueda L, Selenski C, Willis P, Wilson DM, Witty M, Calderón F..  (2017)  The Discovery of Novel Antimalarial Aminoxadiazoles as a Promising Nonendoperoxide Scaffold.,  60  (16): [PMID:28806082] [10.1021/acs.jmedchem.6b01441]

Source