The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-({4-[({(3R,4R)-1-Formyl-3-hydroxy-3-[(hydroxyamino)carbonyl]piperidin-4-yl}amino)sulfonyl]phenoxy}methyl)-2-methylquinolinium trifluoroacetic acid salt ID: ALA4077726
PubChem CID: 87587813
Max Phase: Preclinical
Molecular Formula: C26H27F3N4O9S
Molecular Weight: 514.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CCN(C=O)C[C@]3(O)C(=O)NO)cc2)c2ccccc2n1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C24H26N4O7S.C2HF3O2/c1-16-12-17(20-4-2-3-5-21(20)25-16)13-35-18-6-8-19(9-7-18)36(33,34)27-22-10-11-28(15-29)14-24(22,31)23(30)26-32;3-2(4,5)1(6)7/h2-9,12,15,22,27,31-32H,10-11,13-14H2,1H3,(H,26,30);(H,6,7)/t22-,24-;/m1./s1
Standard InChI Key: PGGXYVFZACPWGT-NOURSWRJSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
14.8210 -6.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5354 -6.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2499 -6.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5354 -5.1959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2499 -7.2583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9644 -6.0208 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9584 -6.8417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0584 -9.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4751 -10.1792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.8874 -9.4600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3319 -9.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3308 -10.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0456 -10.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0439 -8.9289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7593 -9.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7600 -10.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4753 -10.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1903 -10.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1856 -9.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4697 -8.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6174 -8.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0475 -11.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3341 -11.8211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6186 -11.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6213 -10.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9067 -10.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1923 -10.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1968 -11.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9120 -11.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7633 -10.5946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7663 -11.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0522 -11.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0532 -12.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7674 -13.0635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4822 -12.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4829 -11.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3382 -11.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3393 -10.5900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6233 -11.8266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9093 -11.4132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4625 -12.4084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7673 -13.8885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0528 -14.3009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
3 6 1 0
3 7 1 0
9 8 2 0
10 9 2 0
11 12 2 0
12 13 1 0
13 16 2 0
15 14 2 0
14 11 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
11 21 1 0
13 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 9 1 0
9 30 1 0
31 30 1 6
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
32 37 1 6
37 38 2 0
37 39 1 0
39 40 1 0
32 41 1 0
34 42 1 0
42 43 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.56Molecular Weight (Monoisotopic): 514.1522AlogP: 0.87#Rotatable Bonds: 8Polar Surface Area: 158.16Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.56CX Basic pKa: 5.02CX LogP: 0.07CX LogD: 0.04Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -0.75
References 1. Ouvry G, Berton Y, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Chambon S, Comino C, Deprez B, Duvert D, Duvert G, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Pascau J, Pinto A, Polge G, Reitz A, Reversé K, Rosignoli C, Taquet N, Hennequin LF.. (2017) Identification of novel TACE inhibitors compatible with topical application., 27 (8): [PMID:28274635 ] [10.1016/j.bmcl.2017.02.035 ]