(R)-7-Ethanesulfonyl-4-methyl-2-(1-oxo-1,2-dihydro-isoquinolin-7-ylamino)-13-oxa-4,11-diaza-tricyclo[14.2.2.1(6,10)]henicosa-1(19),6,8,10(21),16(20),17-hexaene-3,12-dione

ID: ALA4077853

PubChem CID: 137650038

Max Phase: Preclinical

Molecular Formula: C30H30N4O6S

Molecular Weight: 574.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc2cc1CN(C)C(=O)[C@H](Nc1ccc3cc[nH]c(=O)c3c1)c1ccc(cc1)CCOC(=O)N2

Standard InChI:  InChI=1S/C30H30N4O6S/c1-3-41(38,39)26-11-10-23-16-22(26)18-34(2)29(36)27(21-6-4-19(5-7-21)13-15-40-30(37)33-23)32-24-9-8-20-12-14-31-28(35)25(20)17-24/h4-12,14,16-17,27,32H,3,13,15,18H2,1-2H3,(H,31,35)(H,33,37)/t27-/m1/s1

Standard InChI Key:  OGQMEBCFZZRVNB-HHHXNRCGSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   13.8197  -13.3408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0024  -13.3408    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.4110  -14.0486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7135  -11.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2722   -9.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7165  -10.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2834  -11.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1408  -12.1221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2702   -8.8165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0027  -12.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8543  -12.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9999  -12.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1445  -13.3546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9893  -10.0519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5686  -12.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4227   -8.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0000  -11.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2877  -12.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4263   -9.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5614  -10.0585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8533  -13.3595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7148  -12.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8377   -8.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1469  -12.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1419  -10.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7097  -10.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8212  -10.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1432  -11.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2830  -12.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5748  -12.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5704  -11.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9955  -10.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1432  -10.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2804  -10.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7148  -12.5350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4302  -11.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8599  -12.1163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4322  -12.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2974  -13.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2990  -14.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8580  -11.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
 18 10  2  0
 38 24  1  0
 19 26  1  0
 11 21  2  0
 29 12  2  0
 16 23  1  0
 38 36  1  6
 30 18  1  0
 31 15  2  0
 28 27  2  0
 14  5  1  0
 11  8  1  0
  6 36  1  0
 35 38  1  0
 19 16  1  0
 31 27  1  0
 33 25  1  0
 15 29  1  0
  8 28  1  0
 12 17  1  0
  9 23  1  0
  4 32  1  0
 17 34  2  0
  7 18  1  0
 24 37  1  0
 32 14  1  0
 24 13  2  0
 26  6  2  0
 25 19  2  0
 34 31  1  0
 32  7  2  0
  5  9  1  0
 10 22  1  0
 36 33  2  0
 15 11  1  0
 22  4  2  0
 12 35  1  0
  5 20  2  0
 37 30  1  0
 10  2  1  0
  2 39  1  0
 39 40  1  0
 37 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4077853

    ---

Associated Targets(Human)

F7 Tchem Coagulation factor VII (948 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (7708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.66Molecular Weight (Monoisotopic): 574.1886AlogP: 4.24#Rotatable Bonds: 4
Polar Surface Area: 137.67Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.34CX Basic pKa: 0.49CX LogP: 2.82CX LogD: 2.82
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.33Np Likeness Score: -0.23

References

1. Wurtz NR, Parkhurst BL, DeLucca I, Glunz PW, Jiang W, Zhang X, Cheney DL, Bozarth JM, Rendina AR, Wei A, Harper T, Luettgen JM, Wu Y, Wong PC, Seiffert DA, Wexler RR, Priestley ES..  (2017)  Neutral macrocyclic factor VIIa inhibitors.,  27  (12): [PMID:28460818] [10.1016/j.bmcl.2017.04.008]

Source