The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(3-(4-isopropylpiperazin-1-yl)prop-1-ynyl)benzyl)(neopentyl)amino)pyrimidine-2-carbonitrile ID: ALA4078089
PubChem CID: 10003594
Max Phase: Preclinical
Molecular Formula: C27H36N6
Molecular Weight: 444.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCN(CC#Cc2ccc(CN(CC(C)(C)C)c3ccnc(C#N)n3)cc2)CC1
Standard InChI: InChI=1S/C27H36N6/c1-22(2)32-17-15-31(16-18-32)14-6-7-23-8-10-24(11-9-23)20-33(21-27(3,4)5)26-12-13-29-25(19-28)30-26/h8-13,22H,14-18,20-21H2,1-5H3
Standard InChI Key: QLDSKZZPAMCGOO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
2.0539 -4.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0528 -5.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7650 -5.4506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4788 -5.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4759 -4.2144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7632 -3.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1855 -5.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8980 -5.8584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7607 -2.9837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4714 -2.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0477 -2.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0452 -1.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3322 -1.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7559 -1.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0389 -0.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1803 -2.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1806 -3.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8928 -4.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6044 -3.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5993 -2.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8865 -2.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3159 -4.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0294 -4.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7430 -5.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4531 -4.5992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1607 -5.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8687 -4.5985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8694 -3.7768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1559 -3.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4459 -3.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5810 -3.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2930 -3.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5805 -2.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 3 0
4 7 1 0
6 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
12 15 1 0
10 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 3 0
19 22 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.63Molecular Weight (Monoisotopic): 444.3001AlogP: 3.78#Rotatable Bonds: 6Polar Surface Area: 59.29Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.29CX LogP: 5.72CX LogD: 4.78Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -1.37
References 1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P.. (2017) Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis., 25 (16): [PMID:28689977 ] [10.1016/j.bmc.2017.06.050 ]