4-((4-(3-(4-isopropylpiperazin-1-yl)prop-1-ynyl)benzyl)(neopentyl)amino)pyrimidine-2-carbonitrile

ID: ALA4078089

PubChem CID: 10003594

Max Phase: Preclinical

Molecular Formula: C27H36N6

Molecular Weight: 444.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1CCN(CC#Cc2ccc(CN(CC(C)(C)C)c3ccnc(C#N)n3)cc2)CC1

Standard InChI:  InChI=1S/C27H36N6/c1-22(2)32-17-15-31(16-18-32)14-6-7-23-8-10-24(11-9-23)20-33(21-27(3,4)5)26-12-13-29-25(19-28)30-26/h8-13,22H,14-18,20-21H2,1-5H3

Standard InChI Key:  QLDSKZZPAMCGOO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    2.0539   -4.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0528   -5.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7650   -5.4506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4788   -5.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4759   -4.2144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7632   -3.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1855   -5.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8980   -5.8584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7607   -2.9837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4714   -2.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0477   -2.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0452   -1.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3322   -1.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7559   -1.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0389   -0.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1803   -2.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1806   -3.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8928   -4.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6044   -3.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5993   -2.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8865   -2.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3159   -4.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0294   -4.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7430   -5.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4531   -4.5992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1607   -5.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8687   -4.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8694   -3.7768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1559   -3.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4459   -3.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5810   -3.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2930   -3.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5805   -2.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  3  0
  4  7  1  0
  6  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  1  0
 12 15  1  0
 10 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  3  0
 19 22  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 31 33  1  0
M  END

Associated Targets(Human)

CTSK Tchem Cathepsin K (3011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GPR65 Tbio Psychosine receptor (13 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GPR4 Tchem G-protein coupled receptor 4 (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.63Molecular Weight (Monoisotopic): 444.3001AlogP: 3.78#Rotatable Bonds: 6
Polar Surface Area: 59.29Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.29CX LogP: 5.72CX LogD: 4.78
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -1.37

References

1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P..  (2017)  Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis.,  25  (16): [PMID:28689977] [10.1016/j.bmc.2017.06.050]

Source