D-Arg4-Leu10-Teixobactin

ID: ALA4078139

PubChem CID: 137650538

Max Phase: Preclinical

Molecular Formula: C59H100N14O14

Molecular Weight: 1229.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CC[C@@H](C)[C@@H](NC(=O)[C@@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H](Cc1ccccc1)NC)[C@@H](C)CC)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)O[C@H]1C)[C@@H](C)CC

Standard InChI: InChI=1S/C59H100N14O14/c1-14-31(7)43(70-50(78)39(62-13)27-37-22-19-18-20-23-37)54(82)67-41(28-74)52(80)65-38(24-21-25-63-59(60)61)49(77)69-45(33(9)16-3)56(84)71-44(32(8)15-2)55(83)68-42(29-75)53(81)73-47-36(12)87-58(86)46(34(10)17-4)72-51(79)40(26-30(5)6)66-48(76)35(11)64-57(47)85/h18-20,22-23,30-36,38-47,62,74-75H,14-17,21,24-29H2,1-13H3,(H,64,85)(H,65,80)(H,66,76)(H,67,82)(H,68,83)(H,69,77)(H,70,78)(H,71,84)(H,72,79)(H,73,81)(H4,60,61,63)/t31-,32-,33+,34-,35-,36-,38+,39+,40-,41-,42-,43-,44-,45+,46-,47+/m0/s1

Standard InChI Key: ICVZMOGBTWZOQW-AUSGJWLPSA-N

Molfile:

     RDKit          2D

 87 88  0  0  0  0  0  0  0  0999 V2000
    2.3609   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0744   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7879   -7.5102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5014   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2149   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9325   -7.0959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6459   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3594   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0729   -7.5102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7864   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4999   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2133   -7.0959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9311   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6445   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3580   -7.5102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0715   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7850   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7850   -8.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4985   -7.0959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2119   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9297   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9297   -6.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6431   -7.5102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3566   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0701   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0701   -8.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7836   -7.0959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4971   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2105   -7.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9281   -7.5102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2105   -6.2713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8628   -5.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2105   -4.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4971   -5.0367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7836   -4.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0701   -5.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0701   -5.8611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3566   -6.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3566   -4.6223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4971   -8.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2119   -8.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4985   -8.7449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0715   -6.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7850   -5.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7850   -5.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3580   -5.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6445   -6.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9311   -8.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2133   -8.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2133   -9.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6445   -8.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4999   -8.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7864   -6.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0729   -5.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0729   -5.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7864   -4.6223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3594   -6.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6459   -8.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9325   -8.7449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2149   -8.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5014   -6.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2149   -5.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7879   -5.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7879   -5.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0744   -6.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6474   -7.0959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9340   -7.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3609   -8.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6474   -8.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9355   -8.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2225   -8.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2221   -9.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9406   -9.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6506   -9.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6393   -5.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7836   -3.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5012   -3.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0659   -3.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0659   -2.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3675   -3.8087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9060   -5.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4332   -4.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4764   -4.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9171   -3.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5051   -5.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2217   -4.6187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5072   -5.8636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  1
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  1
 14 15  1  0
 16 15  1  1
 16 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 24 23  1  6
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  6
 36 35  1  0
 37 36  1  0
 38 37  1  0
 24 38  1  0
 36 39  2  0
 28 40  1  6
 20 41  1  6
 41 42  1  0
 16 43  1  0
 43 44  1  0
 44 45  1  0
 43 46  1  1
 14 47  2  0
 13 48  1  0
 48 49  1  0
 49 50  1  0
 48 51  1  6
 11 52  2  0
 10 53  1  6
 53 54  1  0
 54 55  1  0
 55 56  1  0
  8 57  2  0
  7 58  1  6
 58 59  1  0
  5 60  2  0
  4 61  1  0
 61 62  1  6
 61 63  1  0
 63 64  1  0
  2 65  2  0
  1 66  1  0
 66 67  1  0
  1 68  1  1
 68 69  1  0
 69 70  2  0
 70 71  1  0
 71 72  2  0
 72 73  1  0
 73 74  2  0
 74 69  1  0
 38 75  1  6
 35 76  1  0
 76 77  1  6
 76 78  1  0
 78 79  1  0
 33 80  2  0
 32 81  1  6
 81 82  1  0
 82 83  1  0
 82 84  1  0
 56 85  1  0
 85 86  1  0
 85 87  2  0
M  END

Associated Targets(non-human)

Staphylococcus saprophyticus (562 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Staphylococcus aureus (210822 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Enterococcus faecalis (29875 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Staphylococcus epidermidis (22802 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Bacillus cereus (7522 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Pseudomonas aeruginosa (123386 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Oryctolagus cuniculus (11301 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1229.53	Molecular Weight (Monoisotopic): 1228.7543	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Parmar A, Lakshminarayanan R, Iyer A, Mayandi V, Leng Goh ET, Lloyd DG, Chalasani MLS, Verma NK, Prior SH, Beuerman RW, Madder A, Taylor EJ, Singh I.. (2018) Design and Syntheses of Highly Potent Teixobactin Analogues against Staphylococcus aureus, Methicillin-Resistant Staphylococcus aureus (MRSA), and Vancomycin-Resistant Enterococci (VRE) in Vitro and in Vivo., 61 (5): [PMID:29363971] [10.1021/acs.jmedchem.7b01634]

D-Arg4-Leu10-Teixobactin

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source