2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 3-fluorobenzoate

ID: ALA4078230

PubChem CID: 34885361

Max Phase: Preclinical

Molecular Formula: C13H12FN3O4

Molecular Weight: 293.25

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1cccc(F)c1

Standard InChI:  InChI=1S/C13H12FN3O4/c1-9-15-8-12(17(19)20)16(9)5-6-21-13(18)10-3-2-4-11(14)7-10/h2-4,7-8H,5-6H2,1H3

Standard InChI Key:  ISSPMVFGTDUVRU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   33.7555   -2.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4100   -1.7065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1486   -0.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3289   -0.9429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0900   -1.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7656   -3.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1924   -1.9491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7928   -1.3947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3723   -2.7462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4783   -3.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4885   -4.2299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2012   -4.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2113   -5.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9038   -4.2123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3165   -1.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5080   -5.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5177   -6.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2310   -7.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9359   -6.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9226   -5.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6500   -7.0516    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 19 21  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 293.25Molecular Weight (Monoisotopic): 293.0812AlogP: 2.10#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 2.18CX LogD: 2.18
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.48Np Likeness Score: -1.95

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source