Isopropyl (2S)-2-[[[(8R,9S,13S,14S,17S)-17-Hydroxyl-13-methyl-6,7,8,9,11,12, 14,15,16,17-decahydrocyclopenta[a]-phenanthrene-3-yl]oxy(methoxymethyl)phosphoryl]amino]-propanoate

ID: ALA4079329

PubChem CID: 137651535

Max Phase: Preclinical

Molecular Formula: C26H40NO6P

Molecular Weight: 493.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12

Standard InChI:  InChI=1S/C26H40NO6P/c1-16(2)32-25(29)17(3)27-34(30,15-31-5)33-19-7-9-20-18(14-19)6-8-22-21(20)12-13-26(4)23(22)10-11-24(26)28/h7,9,14,16-17,21-24,28H,6,8,10-13,15H2,1-5H3,(H,27,30)/t17-,21+,22+,23-,24-,26-,34?/m0/s1

Standard InChI Key:  CAJLYEOLCGJIKH-GGCXRRCPSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   17.0110  -11.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0099  -12.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7179  -12.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7161  -10.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4248  -11.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4236  -12.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1337  -12.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8495  -12.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1360  -10.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8506  -11.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8610   -9.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1381   -9.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5755  -10.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5668  -10.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3502  -11.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8432  -10.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3643   -9.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5701   -9.1831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6250   -8.9800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8437  -10.4171    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.3018  -12.4619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1297  -11.6305    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.5619  -11.6429    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.5945  -12.0527    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   14.8864  -12.4607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5951  -11.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8053  -12.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2270  -13.4196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4379  -14.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1790  -12.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4710  -12.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1797  -11.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7636  -12.0505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4704  -13.2768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0556  -12.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3482  -12.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0549  -13.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 13 18  1  1
 17 19  1  1
 10 20  1  1
  2 21  1  0
  9 22  1  6
 14 23  1  6
 21 24  1  0
 24 25  1  0
 24 26  2  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 30 32  1  6
 31 33  1  0
 31 34  2  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4079329

    ---

Associated Targets(non-human)

Canis familiaris (36305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.58Molecular Weight (Monoisotopic): 493.2593AlogP: 5.01#Rotatable Bonds: 8
Polar Surface Area: 94.09Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.36CX Basic pKa: CX LogP: 4.04CX LogD: 4.04
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: 1.03

References

1. Wei Y, Qiu G, Lei B, Qin L, Chu H, Lu Y, Zhu G, Gao Q, Huang Q, Qian G, Liao P, Luo X, Zhang X, Zhang C, Li Y, Zheng S, Yu Y, Tang P, Ni J, Yan P, Zhou Y, Li P, Huang X, Gong A, Liu J..  (2017)  Oral Delivery of Propofol with Methoxymethylphosphonic Acid as the Delivery Vehicle.,  60  (20): [PMID:28968087] [10.1021/acs.jmedchem.7b01133]

Source