The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3(S)-[N-(3alpha-Hydroxy-5beta-cholan-24-oyl)amino]-4-(benzothiophen-3-yl)butanoic acid ID: ALA4079387
PubChem CID: 137651550
Max Phase: Preclinical
Molecular Formula: C36H51NO4S
Molecular Weight: 593.87
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCC(=O)N[C@H](CC(=O)O)Cc1csc2ccccc12)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C36H51NO4S/c1-22(8-13-33(39)37-25(20-34(40)41)18-23-21-42-32-7-5-4-6-27(23)32)29-11-12-30-28-10-9-24-19-26(38)14-16-35(24,2)31(28)15-17-36(29,30)3/h4-7,21-22,24-26,28-31,38H,8-20H2,1-3H3,(H,37,39)(H,40,41)/t22-,24-,25+,26-,28+,29-,30+,31+,35+,36-/m1/s1
Standard InChI Key: OAGRQPFMWZGWCS-ZOOAIUBFSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
15.3574 -4.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3574 -5.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0627 -5.8607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0627 -4.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7680 -4.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7690 -5.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4733 -5.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1811 -5.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4712 -4.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1820 -4.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1808 -2.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4675 -3.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8915 -3.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8884 -4.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6689 -4.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1544 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6739 -3.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6503 -5.8658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7607 -3.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7648 -6.2693 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.4664 -5.0435 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.1763 -3.8177 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.8821 -5.0476 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.8862 -2.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9293 -2.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7293 -2.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3848 -1.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2738 -2.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0738 -2.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3292 -1.8818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4587 -2.9427 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.6183 -3.2674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4183 -3.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6737 -2.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4737 -2.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7291 -1.3811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0182 -2.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9628 -3.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7074 -4.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9298 -4.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9267 -5.5525 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.1857 -5.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7023 -5.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0284 -6.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8376 -6.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3197 -5.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9909 -5.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
2 18 1 6
5 19 1 1
6 20 1 1
9 21 1 6
10 22 1 1
14 23 1 6
13 24 1 1
17 25 1 0
25 26 1 0
25 27 1 6
26 28 1 0
28 29 1 0
29 30 2 0
17 31 1 6
29 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
35 37 1 0
33 38 1 6
38 39 1 0
39 40 2 0
40 41 1 0
41 43 1 0
42 39 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.87Molecular Weight (Monoisotopic): 593.3539AlogP: 7.84#Rotatable Bonds: 9Polar Surface Area: 86.63Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.02CX Basic pKa: ┄CX LogP: 7.10CX LogD: 4.75Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.28Np Likeness Score: 1.02
References 1. Incerti M, Russo S, Callegari D, Pala D, Giorgio C, Zanotti I, Barocelli E, Vicini P, Vacondio F, Rivara S, Castelli R, Tognolini M, Lodola A.. (2017) Metadynamics for Perspective Drug Design: Computationally Driven Synthesis of New Protein-Protein Interaction Inhibitors Targeting the EphA2 Receptor., 60 (2): [PMID:28005388 ] [10.1021/acs.jmedchem.6b01642 ]