The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-((11-oxo-3-(3-(pyrrolidin-1-yl)propanamido)-7,8,9,11-tetrahydro-6H-pyrido[2,1-b]quinazolin-6-ylidene)methyl)phenyl)-3-(pyrrolidin-1-yl)propanamide ID: ALA4079924
PubChem CID: 54771253
Max Phase: Preclinical
Molecular Formula: C33H40N6O3
Molecular Weight: 568.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCN1CCCC1)Nc1ccc(/C=C2\CCCn3c2nc2cc(NC(=O)CCN4CCCC4)ccc2c3=O)cc1
Standard InChI: InChI=1S/C33H40N6O3/c40-30(13-20-37-15-1-2-16-37)34-26-9-7-24(8-10-26)22-25-6-5-19-39-32(25)36-29-23-27(11-12-28(29)33(39)42)35-31(41)14-21-38-17-3-4-18-38/h7-12,22-23H,1-6,13-21H2,(H,34,40)(H,35,41)/b25-22+
Standard InChI Key: IORXHVSFCDPREC-YYDJUVGSSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
9.5652 -10.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5735 -11.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2853 -11.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2917 -12.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0027 -13.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7072 -12.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6963 -11.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9847 -11.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4196 -13.0066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1225 -12.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8349 -12.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1132 -11.7727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5379 -12.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2502 -12.9741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3407 -13.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1419 -13.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5424 -13.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9886 -12.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1508 -10.5946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1508 -8.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4455 -10.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4481 -9.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7443 -8.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0376 -9.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0390 -10.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7433 -10.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1494 -8.1430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3321 -10.6013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6235 -10.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 -10.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6219 -9.3770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2081 -10.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 -10.6071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7500 -10.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2058 -10.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6145 -11.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4135 -11.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8526 -9.3730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8605 -10.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2665 -10.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2586 -9.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5494 -8.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
22 20 1 0
21 19 1 0
19 39 2 0
38 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
20 27 2 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 33 1 0
38 39 1 0
38 42 1 0
39 1 1 0
1 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.72Molecular Weight (Monoisotopic): 568.3162AlogP: 4.58#Rotatable Bonds: 9Polar Surface Area: 99.57Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.21CX Basic pKa: 9.69CX LogP: 3.27CX LogD: -0.69Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.39Np Likeness Score: -0.99
References 1. Shan C, Yan JW, Wang YQ, Che T, Huang ZL, Chen AC, Yao PF, Tan JH, Li D, Ou TM, Gu LQ, Huang ZS.. (2017) Design, Synthesis, and Evaluation of Isaindigotone Derivatives To Downregulate c-myc Transcription via Disrupting the Interaction of NM23-H2 with G-Quadruplex., 60 (4): [PMID:28128954 ] [10.1021/acs.jmedchem.6b01218 ] 2. Wang YQ, Huang ZL, Chen SB, Wang CX, Shan C, Yin QK, Ou TM, Li D, Gu LQ, Tan JH, Huang ZS.. (2017) Design, Synthesis, and Evaluation of New Selective NM23-H2 Binders as c-MYC Transcription Inhibitors via Disruption of the NM23-H2/G-Quadruplex Interaction., 60 (16): [PMID:28714689 ] [10.1021/acs.jmedchem.7b00421 ]