(E)-N-(4-((11-oxo-3-(3-(pyrrolidin-1-yl)propanamido)-7,8,9,11-tetrahydro-6H-pyrido[2,1-b]quinazolin-6-ylidene)methyl)phenyl)-3-(pyrrolidin-1-yl)propanamide

ID: ALA4079924

PubChem CID: 54771253

Max Phase: Preclinical

Molecular Formula: C33H40N6O3

Molecular Weight: 568.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCN1CCCC1)Nc1ccc(/C=C2\CCCn3c2nc2cc(NC(=O)CCN4CCCC4)ccc2c3=O)cc1

Standard InChI:  InChI=1S/C33H40N6O3/c40-30(13-20-37-15-1-2-16-37)34-26-9-7-24(8-10-26)22-25-6-5-19-39-32(25)36-29-23-27(11-12-28(29)33(39)42)35-31(41)14-21-38-17-3-4-18-38/h7-12,22-23H,1-6,13-21H2,(H,34,40)(H,35,41)/b25-22+

Standard InChI Key:  IORXHVSFCDPREC-YYDJUVGSSA-N

Molfile:  

     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
    9.5652  -10.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5735  -11.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2853  -11.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2917  -12.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0027  -13.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7072  -12.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6963  -11.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9847  -11.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4196  -13.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1225  -12.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8349  -12.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1132  -11.7727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5379  -12.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2502  -12.9741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3407  -13.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1419  -13.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5424  -13.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9886  -12.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1508  -10.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1508   -8.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4455  -10.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4481   -9.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7443   -8.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0376   -9.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0390  -10.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7433  -10.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1494   -8.1430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3321  -10.6013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6235  -10.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9167  -10.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6219   -9.3770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2081  -10.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5013  -10.6071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7500  -10.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2058  -10.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6145  -11.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4135  -11.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8526   -9.3730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8605  -10.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2665  -10.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2586   -9.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5494   -8.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
 22 20  1  0
 21 19  1  0
 19 39  2  0
 38 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 20 27  2  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 33  1  0
 38 39  1  0
 38 42  1  0
 39  1  1  0
  1 40  1  0
 40 41  1  0
 41 42  1  0
M  END

Associated Targets(Human)

NME2 Tbio Nucleoside diphosphate kinase 2 (168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.72Molecular Weight (Monoisotopic): 568.3162AlogP: 4.58#Rotatable Bonds: 9
Polar Surface Area: 99.57Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.21CX Basic pKa: 9.69CX LogP: 3.27CX LogD: -0.69
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.39Np Likeness Score: -0.99

References

1. Shan C, Yan JW, Wang YQ, Che T, Huang ZL, Chen AC, Yao PF, Tan JH, Li D, Ou TM, Gu LQ, Huang ZS..  (2017)  Design, Synthesis, and Evaluation of Isaindigotone Derivatives To Downregulate c-myc Transcription via Disrupting the Interaction of NM23-H2 with G-Quadruplex.,  60  (4): [PMID:28128954] [10.1021/acs.jmedchem.6b01218]
2. Wang YQ, Huang ZL, Chen SB, Wang CX, Shan C, Yin QK, Ou TM, Li D, Gu LQ, Tan JH, Huang ZS..  (2017)  Design, Synthesis, and Evaluation of New Selective NM23-H2 Binders as c-MYC Transcription Inhibitors via Disruption of the NM23-H2/G-Quadruplex Interaction.,  60  (16): [PMID:28714689] [10.1021/acs.jmedchem.7b00421]

Source