N-(6-Methyl-3-(phenylthio)pyrido[2,3-b]pyrazin-7-yl)-N'-(4-fluoro-3-nitro phenyl)urea

ID: ALA4080285

PubChem CID: 137648747

Max Phase: Preclinical

Molecular Formula: C21H15FN6O3S

Molecular Weight: 450.46

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1nc2nc(Sc3ccccc3)cnc2cc1NC(=O)Nc1ccc(F)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C21H15FN6O3S/c1-12-16(26-21(29)25-13-7-8-15(22)18(9-13)28(30)31)10-17-20(24-12)27-19(11-23-17)32-14-5-3-2-4-6-14/h2-11H,1H3,(H2,25,26,29)

Standard InChI Key:  NFGQYFMMNIJEKA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   18.1790   -3.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1779   -3.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8859   -4.2290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8841   -2.5916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5928   -2.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5935   -3.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3021   -4.2229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0103   -3.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0056   -2.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2965   -2.5866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4698   -4.2280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.7625   -3.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7676   -3.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0611   -2.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3521   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3541   -3.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0612   -4.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7196   -4.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7108   -2.5771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4210   -2.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1262   -2.5685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4259   -3.7985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8364   -2.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8370   -3.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5463   -4.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2525   -3.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2449   -2.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5350   -2.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9632   -4.1845    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.9508   -2.5435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9429   -1.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6624   -2.9453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  8 18  1  0
  9 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 30 31  2  0
 30 32  1  0
 27 30  1  0
M  CHG  2  30   1  32  -1
M  END

Alternative Forms

1. Parent:

   

   ALA4080285

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 450.46

Molecular Weight (Monoisotopic): 450.0910

AlogP: 5.18

#Rotatable Bonds: 5

Polar Surface Area: 122.94

Molecular Species: NEUTRAL

HBA: 7

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 11.13

CX Basic pKa: 1.78

CX LogP: 4.55

CX LogD: 4.55

Aromatic Rings: 4

Heavy Atoms: 32

QED Weighted: 0.32

Np Likeness Score: -1.94

References

1. Argyros O, Lougiakis N, Kouvari E, Papafotika A, Raptopoulou CP, Psycharis V, Christoforidis S, Pouli N, Marakos P, Tamvakopoulos C..  (2017)  Design and synthesis of novel 7-aminosubstituted pyrido[2,3-b]pyrazines exhibiting anti-breast cancer activity.,  126  [PMID:28006668] [10.1016/j.ejmech.2016.12.025]

Source

Source(1):

• Scientific Literature