The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Carbamoyl-2-(4-(morpholinomethyl)benzamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-6-carboxylic acid, ammonia salt ID: ALA4080558
PubChem CID: 137648291
Max Phase: Preclinical
Molecular Formula: C22H28N4O5S
Molecular Weight: 443.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N.NC(=O)c1c(NC(=O)c2ccc(CN3CCOCC3)cc2)sc2c1CCC(C(=O)O)C2
Standard InChI: InChI=1S/C22H25N3O5S.H3N/c23-19(26)18-16-6-5-15(22(28)29)11-17(16)31-21(18)24-20(27)14-3-1-13(2-4-14)12-25-7-9-30-10-8-25;/h1-4,15H,5-12H2,(H2,23,26)(H,24,27)(H,28,29);1H3
Standard InChI Key: HIXXIVUOGDTWJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
12.3161 -15.9696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9305 -15.1179 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.1874 -14.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5180 -13.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5168 -13.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2306 -12.6083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8015 -12.6105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9724 -14.0799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5847 -14.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3698 -14.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4121 -15.4396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9780 -14.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7625 -14.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9358 -13.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3184 -13.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5364 -13.5755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1054 -15.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8514 -14.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0534 -14.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5039 -14.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7579 -15.5569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5615 -15.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7204 -13.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3335 -14.1703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1576 -14.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7667 -15.5258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5531 -15.2748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7268 -14.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1142 -13.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2057 -16.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3987 -15.9982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4605 -16.9547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17 2 1 0
2 3 1 0
3 4 2 0
4 18 1 0
4 5 1 0
5 6 1 0
5 7 2 0
3 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
17 18 2 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
14 23 1 0
23 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
21 30 1 0
30 31 1 0
30 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.53Molecular Weight (Monoisotopic): 443.1515AlogP: 2.12#Rotatable Bonds: 6Polar Surface Area: 121.96Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.55CX Basic pKa: 6.60CX LogP: 0.46CX LogD: -0.16Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -1.62
References 1. Llona-Minguez S, Fayezi S, Alihemmati A, Juárez-Jiménez J, Piedrafita FJ, Helleday T.. (2017) Tetrahydrobenzothiophene carboxamides: Beyond the kinase domain and into the fatty acid realm., 27 (18): [PMID:28807439 ] [10.1016/j.bmcl.2017.08.006 ]