5-(2-amino-6-phenoxyphenyl)-2-methyl-1H-pyrrole-3-carboxamide

ID: ALA4080820

PubChem CID: 86299220

Max Phase: Preclinical

Molecular Formula: C18H17N3O2

Molecular Weight: 307.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1[nH]c(-c2c(N)cccc2Oc2ccccc2)cc1C(N)=O

Standard InChI:  InChI=1S/C18H17N3O2/c1-11-13(18(20)22)10-15(21-11)17-14(19)8-5-9-16(17)23-12-6-3-2-4-7-12/h2-10,21H,19H2,1H3,(H2,20,22)

Standard InChI Key:  HMGRPWXRXLIZEW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   27.8992   -5.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8981   -5.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6128   -6.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3293   -5.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3264   -5.1090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6110   -4.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6091   -3.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2750   -3.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0178   -2.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1927   -2.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9403   -3.3919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5008   -1.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3214   -2.0190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1630   -1.1824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7057   -1.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0394   -4.6937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7554   -5.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7552   -5.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4703   -6.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1842   -5.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1785   -5.0914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4627   -4.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1846   -4.7002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
  6  7  1  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
 10 15  1  0
  5 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  1 23  1  0
M  END

Associated Targets(Human)

MX1 (889 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 307.35Molecular Weight (Monoisotopic): 307.1321AlogP: 3.46#Rotatable Bonds: 4
Polar Surface Area: 94.13Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.07CX Basic pKa: 3.64CX LogP: 2.34CX LogD: 2.34
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.64Np Likeness Score: -0.56

References

1. Hasvold LA, Sheppard GS, Wang L, Fidanze SD, Liu D, Pratt JK, Mantei RA, Wada CK, Hubbard R, Shen Y, Lin X, Huang X, Warder SE, Wilcox D, Li L, Buchanan FG, Smithee L, Albert DH, Magoc TJ, Park CH, Petros AM, Panchal SC, Sun C, Kovar P, Soni NB, Elmore SW, Kati WM, McDaniel KF..  (2017)  Methylpyrrole inhibitors of BET bromodomains.,  27  (10): [PMID:28268136] [10.1016/j.bmcl.2017.02.057]

Source