The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,4R)-4-(4-((E)-3-(2-aminophenylamino)-3-oxoprop-1-enyl)-1H-1,2,3-triazol-1-yl)-1-phenethylpyrrolidine-2-carboxylic acid ID: ALA4080937
PubChem CID: 137646189
Max Phase: Preclinical
Molecular Formula: C24H26N6O3
Molecular Weight: 446.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccccc1NC(=O)/C=C/c1cn([C@@H]2C[C@H](C(=O)O)N(CCc3ccccc3)C2)nn1
Standard InChI: InChI=1S/C24H26N6O3/c25-20-8-4-5-9-21(20)26-23(31)11-10-18-15-30(28-27-18)19-14-22(24(32)33)29(16-19)13-12-17-6-2-1-3-7-17/h1-11,15,19,22H,12-14,16,25H2,(H,26,31)(H,32,33)/b11-10+/t19-,22-/m1/s1
Standard InChI Key: HIULRIYRAKJRNA-VTXMGJMISA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.3642 -11.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3624 -12.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0720 -12.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7841 -12.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7798 -11.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0693 -10.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0717 -13.4142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4941 -12.5900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2023 -12.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9123 -12.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -11.3584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6246 -12.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3346 -12.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4182 -13.3995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2212 -13.5684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6281 -12.8583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0787 -12.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4423 -12.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9917 -13.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7382 -13.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6521 -12.2277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8492 -12.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2613 -11.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0391 -11.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6483 -11.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4256 -11.6353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0342 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8617 -10.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0765 -10.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4729 -10.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4483 -13.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4503 -14.2744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1605 -13.0427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 13 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
18 16 1 1
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
20 31 1 1
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.2066AlogP: 2.45#Rotatable Bonds: 8Polar Surface Area: 126.37Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.41CX Basic pKa: 9.95CX LogP: -0.04CX LogD: -0.04Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.95
References 1. Tian Y, Lv W, Li X, Wang C, Wang D, Wang PG, Jin J, Shen J.. (2017) Stabilizing HDAC11 with SAHA to assay slow-binding benzamide inhibitors., 27 (13): [PMID:28501514 ] [10.1016/j.bmcl.2017.05.004 ]