The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(tert-Butyl)-N-(2-methyl-3-(1-methyl-5-((4-(morpholine-4-carbonyl)-3-propionamidophenyl)amino)-6-oxo-1,6-dihydropyridin-3-yl)phenyl)benzamide ID: ALA4081428
PubChem CID: 137475454
Max Phase: Preclinical
Molecular Formula: C38H43N5O5
Molecular Weight: 649.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cc(Nc2cc(-c3cccc(NC(=O)c4ccc(C(C)(C)C)cc4)c3C)cn(C)c2=O)ccc1C(=O)N1CCOCC1
Standard InChI: InChI=1S/C38H43N5O5/c1-7-34(44)40-32-22-28(15-16-30(32)36(46)43-17-19-48-20-18-43)39-33-21-26(23-42(6)37(33)47)29-9-8-10-31(24(29)2)41-35(45)25-11-13-27(14-12-25)38(3,4)5/h8-16,21-23,39H,7,17-20H2,1-6H3,(H,40,44)(H,41,45)
Standard InChI Key: SENQYYGFRJAZIB-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
37.6719 -10.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6708 -11.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3788 -12.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0885 -11.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0857 -10.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3770 -10.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7888 -10.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4983 -10.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2040 -10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2014 -9.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4872 -9.2762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7844 -9.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9070 -9.2697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4812 -8.4590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9131 -10.9062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6194 -10.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3746 -9.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9641 -10.5081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2565 -10.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5487 -10.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2567 -11.7340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3238 -10.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0297 -10.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0274 -9.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3134 -9.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6105 -9.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5521 -9.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8452 -9.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1366 -9.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1394 -10.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8470 -10.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7333 -9.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4429 -9.6692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.7295 -8.4467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4282 -9.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4269 -8.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7212 -9.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7165 -8.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4424 -10.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1479 -10.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.8562 -10.4852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.8543 -9.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1443 -9.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3079 -8.4524 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5974 -8.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5918 -7.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8925 -8.4621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2967 -6.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 2 0
5 7 1 0
10 13 2 0
11 14 1 0
9 15 1 0
15 16 1 0
6 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
16 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 16 1 0
20 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 20 1 0
24 32 1 0
32 33 1 0
32 34 2 0
29 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
33 39 1 0
33 43 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
25 44 1 0
44 45 1 0
45 46 1 0
45 47 2 0
46 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 649.79Molecular Weight (Monoisotopic): 649.3264AlogP: 6.48#Rotatable Bonds: 8Polar Surface Area: 121.77Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.92CX Basic pKa: ┄CX LogP: 5.76CX LogD: 5.76Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.20Np Likeness Score: -1.49
References 1. Liang Q, Chen Y, Yu K, Chen C, Zhang S, Wang A, Wang W, Wu H, Liu X, Wang B, Wang L, Hu Z, Wang W, Ren T, Zhang S, Liu Q, Yun CH, Liu J.. (2017) Discovery of N-(3-(5-((3-acrylamido-4-(morpholine-4-carbonyl)phenyl)amino)-1-methyl-6-oxo-1,6-dihydropyridin-3-yl)-2-methylphenyl)-4-(tert-butyl)benzamide (CHMFL-BTK-01) as a highly selective irreversible Bruton's tyrosine kinase (BTK) inhibitor., 131 [PMID:28315597 ] [10.1016/j.ejmech.2017.03.001 ]