2-(Benzo[d]isoxazol-3-yl)-N-(3-chloro-4-(trifluoromethyl)phenyl)-2-oxoacetohydrazonoyl cyanide

ID: ALA4081514

PubChem CID: 137647401

Max Phase: Preclinical

Molecular Formula: C17H8ClF3N4O2

Molecular Weight: 392.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C/C(=N\Nc1ccc(C(F)(F)F)c(Cl)c1)C(=O)c1noc2ccccc12

Standard InChI:  InChI=1S/C17H8ClF3N4O2/c18-12-7-9(5-6-11(12)17(19,20)21)23-24-13(8-22)16(26)15-10-3-1-2-4-14(10)27-25-15/h1-7,23H/b24-13+

Standard InChI Key:  LDYLGZUBSMGFNY-ZMOGYAJESA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   42.0798  -25.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0787  -26.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7908  -27.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5046  -26.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5018  -25.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7890  -25.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7866  -24.6475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4972  -24.2327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4948  -23.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2054  -23.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2029  -22.1793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9184  -23.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2138  -23.6805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.6610  -23.0708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7786  -23.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0655  -22.5973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.3665  -27.1135    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   45.8073  -24.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0049  -24.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4566  -24.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7094  -25.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5157  -25.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0605  -25.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7906  -27.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0787  -28.3442    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   43.5024  -28.3445    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   42.7829  -28.7544    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 19  1  0
 18 13  1  0
 13 14  1  0
 14 12  2  0
 15 16  3  0
  9 15  1  0
  2 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  3 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4081514

    ---

Associated Targets(Human)

RAPGEF3 Tchem Rap guanine nucleotide exchange factor 3 (15528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rapgef4 Rap guanine nucleotide exchange factor 4 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.72Molecular Weight (Monoisotopic): 392.0288AlogP: 4.67#Rotatable Bonds: 4
Polar Surface Area: 91.28Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.69CX Basic pKa: CX LogP: 5.37CX LogD: 3.67
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.40Np Likeness Score: -1.62

References

1. Ye N, Zhu Y, Liu Z, Mei FC, Chen H, Wang P, Cheng X, Zhou J..  (2017)  Identification of novel 2-(benzo[d]isoxazol-3-yl)-2-oxo-N-phenylacetohydrazonoyl cyanide analoguesas potent EPAC antagonists.,  134  [PMID:28399451] [10.1016/j.ejmech.2017.04.001]

Source