The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-benzyl 2-(2-(benzyloxycarbonylamino)acetamido)-6-((2S,3R)-3-hexyl-4-oxooxetane-2-carboxamido)hexanoate ID: ALA4081526
PubChem CID: 137647871
Max Phase: Preclinical
Molecular Formula: C33H43N3O8
Molecular Weight: 609.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC[C@H]1C(=O)O[C@@H]1C(=O)NCCCC[C@H](NC(=O)CNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1
Standard InChI: InChI=1S/C33H43N3O8/c1-2-3-4-11-18-26-29(44-31(26)39)30(38)34-20-13-12-19-27(32(40)42-22-24-14-7-5-8-15-24)36-28(37)21-35-33(41)43-23-25-16-9-6-10-17-25/h5-10,14-17,26-27,29H,2-4,11-13,18-23H2,1H3,(H,34,38)(H,35,41)(H,36,37)/t26-,27+,29+/m1/s1
Standard InChI Key: XDCPTKKQNAGZNF-XQFUHLNNSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
16.3718 -9.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6543 -11.1905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7862 -10.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9320 -9.9591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0726 -12.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0666 -9.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4067 -10.8644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5717 -9.1470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2164 -10.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5808 -10.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1634 -10.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6364 -9.9862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8985 -12.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3632 -9.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6551 -11.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6516 -10.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0834 -8.9379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4978 -9.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3550 -10.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8281 -11.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3601 -11.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6499 -11.6348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0756 -11.6258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0807 -12.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3705 -12.8649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6593 -12.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9495 -12.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9542 -13.6934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6747 -14.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3815 -13.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9259 -10.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2108 -9.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9306 -11.2249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5002 -10.4099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7851 -10.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0747 -10.4179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7805 -9.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3594 -10.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6490 -10.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9384 -10.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2284 -10.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2327 -11.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9528 -11.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6599 -11.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 4 1 0
9 18 1 0
10 7 1 0
1 17 2 0
3 6 1 0
6 19 1 0
20 15 1 0
4 9 1 0
18 3 1 0
11 1 1 0
15 5 1 0
7 20 1 0
19 12 1 0
14 16 1 1
11 10 1 6
5 13 1 0
16 2 2 0
14 11 1 0
8 14 1 0
1 8 1 0
19 21 1 1
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
12 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 609.72Molecular Weight (Monoisotopic): 609.3050AlogP: 3.94#Rotatable Bonds: 19Polar Surface Area: 149.13Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.08CX Basic pKa: ┄CX LogP: 4.58CX LogD: 4.58Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: -0.04
References 1. Zhu M, Harshbarger WD, Robles O, Krysiak J, Hull KG, Cho SW, Richardson RD, Yang Y, Garcia A, Spiegelman L, Ramirez B, Wilson CT, Yau JA, Moore JT, Walker CB, Sacchettini JC, Liu WR, Sieber SA, Smith JW, Romo D.. (2017) A strategy for dual inhibition of the proteasome and fatty acid synthase with belactosin C-orlistat hybrids., 25 (11): [PMID:28236510 ] [10.1016/j.bmc.2017.01.020 ]