The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S,7S)-4-Isobutyl-2,5,10-trioxo-17-phenyl-1-oxa-3,6,11-triazacycloheptadecane-7-carbaldehyde ID: ALA4081590
PubChem CID: 137646911
Max Phase: Preclinical
Molecular Formula: C24H35N3O5
Molecular Weight: 445.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H]1NC(=O)OC(c2ccccc2)CCCCCNC(=O)CC[C@@H](C=O)NC1=O
Standard InChI: InChI=1S/C24H35N3O5/c1-17(2)15-20-23(30)26-19(16-28)12-13-22(29)25-14-8-4-7-11-21(32-24(31)27-20)18-9-5-3-6-10-18/h3,5-6,9-10,16-17,19-21H,4,7-8,11-15H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)/t19-,20-,21?/m0/s1
Standard InChI Key: YBYKQGQZOOBUKJ-AHTKWCMKSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
11.6770 -8.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1208 -7.0135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4660 -9.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9841 -8.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8652 -8.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0793 -6.1267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1681 -8.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7666 -4.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5761 -8.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2691 -8.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7598 -9.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4660 -8.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1485 -7.2354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7308 -6.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7598 -8.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0378 -5.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0577 -9.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3920 -8.2146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4099 -7.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0557 -4.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0577 -8.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7128 -6.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3678 -6.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3482 -5.9171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6066 -7.2694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1093 -5.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0897 -4.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9355 -5.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9360 -6.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8509 -4.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8313 -3.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6316 -4.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
18 1 1 0
16 20 1 6
16 14 1 0
11 17 1 0
22 19 1 0
14 22 1 0
19 2 2 0
12 3 1 0
19 18 1 0
5 7 1 0
3 11 2 0
6 16 1 0
7 12 1 0
21 15 1 0
20 8 2 0
13 7 1 0
4 10 1 0
12 15 2 0
17 21 2 0
9 5 1 0
10 9 1 0
13 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 1
26 28 1 0
28 6 1 0
28 29 2 0
27 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.56Molecular Weight (Monoisotopic): 445.2577AlogP: 3.02#Rotatable Bonds: 4Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.61CX Basic pKa: ┄CX LogP: 2.56CX LogD: 2.56Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: 0.77
References 1. Damalanka VC, Kim Y, Galasiti Kankanamalage AC, Lushington GH, Mehzabeen N, Battaile KP, Lovell S, Chang KO, Groutas WC.. (2017) Design, synthesis, and evaluation of a novel series of macrocyclic inhibitors of norovirus 3CL protease., 127 [PMID:28038326 ] [10.1016/j.ejmech.2016.12.033 ]