The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-(Pyrrolidin-1-yl)propoxy)-2-(4-(trifluoromethyl)phenyl)benzo[d]oxazole ID: ALA4081700
PubChem CID: 137647878
Max Phase: Preclinical
Molecular Formula: C21H21F3N2O2
Molecular Weight: 390.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)c1ccc(-c2nc3ccc(OCCCN4CCCC4)cc3o2)cc1
Standard InChI: InChI=1S/C21H21F3N2O2/c22-21(23,24)16-6-4-15(5-7-16)20-25-18-9-8-17(14-19(18)28-20)27-13-3-12-26-10-1-2-11-26/h4-9,14H,1-3,10-13H2
Standard InChI Key: NRRLLDFFSKLECL-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
13.0370 -15.3532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5171 -14.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0370 -14.0259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2598 -14.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2598 -15.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5507 -15.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8457 -15.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8457 -14.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5507 -13.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3343 -14.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7429 -13.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5601 -13.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9687 -14.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5601 -15.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7429 -15.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7859 -14.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1366 -15.5088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4275 -15.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7226 -15.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0135 -15.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3044 -15.5088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2204 -16.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4220 -16.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0134 -15.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5612 -15.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1945 -15.3994 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.1945 -13.9839 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6026 -14.6888 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
5 6 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
13 16 1 0
2 10 1 0
18 19 1 0
19 20 1 0
17 18 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
21 25 1 0
20 21 1 0
7 17 1 0
16 26 1 0
16 27 1 0
16 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.41Molecular Weight (Monoisotopic): 390.1555AlogP: 5.38#Rotatable Bonds: 6Polar Surface Area: 38.50Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.27CX LogP: 4.55CX LogD: 2.69Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: -1.63
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]