(+)-(2S)-1-Benzyl-4-(4-methoxybenzyl)-2-isopropyl-1,4-diazepane

ID: ALA4081826

PubChem CID: 137645291

Max Phase: Preclinical

Molecular Formula: C23H32N2O

Molecular Weight: 352.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CN2CCCN(Cc3ccccc3)[C@@H](C(C)C)C2)cc1

Standard InChI:  InChI=1S/C23H32N2O/c1-19(2)23-18-24(16-21-10-12-22(26-3)13-11-21)14-7-15-25(23)17-20-8-5-4-6-9-20/h4-6,8-13,19,23H,7,14-18H2,1-3H3/t23-/m1/s1

Standard InChI Key:  GBLMQABUUUUQCA-HSZRJFAPSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   19.6894   -9.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4310   -9.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1695   -9.8491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4943  -10.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3462  -10.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0025  -11.2792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8247  -11.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1759  -12.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6420  -12.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8122   -9.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5707   -9.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6809  -10.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4353  -10.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0809  -10.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9669   -9.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2074   -9.1401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8243  -12.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4230  -11.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6060  -11.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1906  -11.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5982  -12.7048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4139  -12.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7102  -12.7006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9903  -12.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8381  -10.5659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9508  -11.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  6  1  0
  5  7  1  0
  6  7  1  0
  7  8  1  6
  6  9  1  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 11 16  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
  9 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  8 23  1  0
  8 24  1  0
 14 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4081826

    ---

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ERG2 C-8 sterol isomerase (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.52Molecular Weight (Monoisotopic): 352.2515AlogP: 4.43#Rotatable Bonds: 6
Polar Surface Area: 15.71Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.66CX LogP: 4.69CX LogD: 2.45
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.76Np Likeness Score: -0.62

References

1. Fanter L, Müller C, Schepmann D, Bracher F, Wünsch B..  (2017)  Chiral-pool synthesis of 1,2,4-trisubstituted 1,4-diazepanes as novel σ1 receptor ligands.,  25  (17): [PMID:28764962] [10.1016/j.bmc.2017.07.027]

Source