N-(2-methoxyphenyl)-2-(methylamino)-6-((4-nitrophenyl)sulfonyl)benzamide

ID: ALA4081832

PubChem CID: 118387001

Max Phase: Preclinical

Molecular Formula: C21H19N3O6S

Molecular Weight: 441.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1cccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1C(=O)Nc1ccccc1OC

Standard InChI:  InChI=1S/C21H19N3O6S/c1-22-17-7-5-9-19(31(28,29)15-12-10-14(11-13-15)24(26)27)20(17)21(25)23-16-6-3-4-8-18(16)30-2/h3-13,22H,1-2H3,(H,23,25)

Standard InChI Key:  RPMHLDCWCUEJPE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   13.0008   -8.1059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2950   -8.5186    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.0053   -8.9234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2981   -6.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5831   -7.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5834   -8.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8766   -8.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1695   -8.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1691   -7.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8759   -6.8727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0053   -7.2795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2978   -6.0475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2868   -9.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9981   -9.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9984  -10.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2875  -10.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5845  -10.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5841   -9.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2878  -11.8004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9991  -12.2112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5810  -12.2110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0046   -5.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0042   -4.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7069   -4.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4182   -4.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4185   -5.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7076   -6.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2888   -4.3967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5703   -4.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8759   -6.0555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5836   -5.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  2  0
  4 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 19 20  2  0
 19 21  1  0
 16 19  1  0
  2 13  1  0
  6  2  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 28 29  1  0
 23 28  1  0
 12 22  1  0
 10 30  1  0
 30 31  1  0
M  CHG  2  19   1  21  -1
M  END

Associated Targets(Human)

H9 (1832 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.47Molecular Weight (Monoisotopic): 441.0995AlogP: 3.73#Rotatable Bonds: 7
Polar Surface Area: 127.64Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.46CX LogP: 3.93CX LogD: 3.93
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.50

References

1. Zhou M, Luo RH, Hou XY, Wang RR, Yan GY, Chen H, Zhang RH, Shi JY, Zheng YT, Li R, Wei YQ..  (2017)  Synthesis, biological evaluation and molecular docking study of N-(2-methoxyphenyl)-6-((4-nitrophenyl)sulfonyl)benzamide derivatives as potent HIV-1 Vif antagonists.,  129  [PMID:28235704] [10.1016/j.ejmech.2017.01.010]

Source