N-(5-(Trifluoromethyl)-2-(((1,4-trans)-4-(3-(3-(trifluoromethyl)phenyl)ureido)cyclohexyl)oxy)phenyl)-acetamide

ID: ALA4081864

PubChem CID: 117954553

Max Phase: Preclinical

Molecular Formula: C23H23F6N3O3

Molecular Weight: 503.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1cc(C(F)(F)F)ccc1O[C@H]1CC[C@H](NC(=O)Nc2cccc(C(F)(F)F)c2)CC1

Standard InChI:  InChI=1S/C23H23F6N3O3/c1-13(33)30-19-12-15(23(27,28)29)5-10-20(19)35-18-8-6-16(7-9-18)31-21(34)32-17-4-2-3-14(11-17)22(24,25)26/h2-5,10-12,16,18H,6-9H2,1H3,(H,30,33)(H2,31,32,34)/t16-,18-

Standard InChI Key:  ZJWKQHOSLVKMRF-SAABIXHNSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   22.0050   -2.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0038   -2.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7119   -3.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4215   -2.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4187   -2.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7101   -1.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9268   -2.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9256   -2.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6337   -3.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3433   -2.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3405   -2.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6319   -1.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0467   -1.7643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7559   -2.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4621   -1.7589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7590   -2.9874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1713   -2.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1721   -2.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8772   -3.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5858   -2.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5847   -2.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8750   -1.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2935   -3.3873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6335   -4.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9257   -4.6333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.3411   -4.6336    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.6257   -5.0393    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.1249   -1.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8341   -2.1496    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.1218   -0.9265    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.8294   -1.3290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.7117   -4.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4193   -4.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4191   -5.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1271   -4.2045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 17 15  1  6
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  1
 23  2  1  0
  9 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  5 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
  3 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Associated Targets(non-human)

Eif2ak1 Eukaryotic translation initiation factor 2-alpha kinase 1 (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 503.44Molecular Weight (Monoisotopic): 503.1644AlogP: 6.19#Rotatable Bonds: 5
Polar Surface Area: 79.46Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.39CX Basic pKa: CX LogP: 4.84CX LogD: 4.84
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.23

References

1. Yefidoff-Freedman R, Fan J, Yan L, Zhang Q, Dos Santos GRR, Rana S, Contreras JI, Sahoo R, Wan D, Young J, Dias Teixeira KL, Morisseau C, Halperin J, Hammock B, Natarajan A, Wang P, Chorev M, Aktas BH..  (2017)  Development of 1-((1,4-trans)-4-Aryloxycyclohexyl)-3-arylurea Activators of Heme-Regulated Inhibitor as Selective Activators of the Eukaryotic Initiation Factor 2 Alpha (eIF2α) Phosphorylation Arm of the Integrated Endoplasmic Reticulum Stress Response.,  60  (13): [PMID:28590739] [10.1021/acs.jmedchem.7b00059]

Source