5-fluoro-1-((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)pyrimidine-2,4(1H,3H)-dione

ID: ALA4081944

PubChem CID: 10708745

Max Phase: Preclinical

Molecular Formula: C10H13FN2O7

Molecular Weight: 292.22

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1F

Standard InChI:  InChI=1S/C10H13FN2O7/c11-3-1-13(10(19)12-8(3)18)9-7(17)6(16)5(15)4(2-14)20-9/h1,4-7,9,14-17H,2H2,(H,12,18,19)/t4-,5-,6+,7-,9-/m1/s1

Standard InChI Key:  YHWGRVDTEORPPJ-XSEHCYKFSA-N

Molfile:  

     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   25.8536   -3.4146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8536   -5.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4332   -5.8737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0168   -5.0540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4331   -3.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3939   -3.9436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1475   -3.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1475   -4.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4331   -5.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7271   -4.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7271   -3.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0168   -3.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5580   -3.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2620   -3.4199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2661   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5601   -2.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8499   -2.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5558   -4.6414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9754   -2.1982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5628   -1.3772    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  6 12  1  0
 11  5  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  1
  7  1  1  1
  8  2  1  6
  9  3  1  1
 10  4  1  6
  1 13  1  0
  1 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 13 18  2  0
 15 19  2  0
 16 20  1  0
M  END

Associated Targets(non-human)

PYGM Glycogen phosphorylase, muscle form (1331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 292.22Molecular Weight (Monoisotopic): 292.0707AlogP: -3.35#Rotatable Bonds: 2
Polar Surface Area: 145.01Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 8.07CX Basic pKa: CX LogP: -2.85CX LogD: -2.93
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.38Np Likeness Score: 0.95

References

1. Bokor É, Kyriakis E, Solovou TGA, Koppány C, Kantsadi AL, Szabó KE, Szakács A, Stravodimos GA, Docsa T, Skamnaki VT, Zographos SE, Gergely P, Leonidas DD, Somsák L..  (2017)  Nanomolar Inhibitors of Glycogen Phosphorylase Based on β-d-Glucosaminyl Heterocycles: A Combined Synthetic, Enzyme Kinetic, and Protein Crystallography Study.,  60  (22): [PMID:28925695] [10.1021/acs.jmedchem.7b01056]

Source