(8R,9S,10R,13S,14S,16S,E)-17-ethylidene-10,13-dimethyl-16-(4-phenyl-1H-1,2,3-triazol-1-yl)-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one

ID: ALA4082032

PubChem CID: 137646688

Max Phase: Preclinical

Molecular Formula: C29H35N3O

Molecular Weight: 441.62

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C1/[C@@H](n2cc(-c3ccccc3)nn2)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C29H35N3O/c1-4-23-27(32-18-26(30-31-32)19-8-6-5-7-9-19)17-25-22-11-10-20-16-21(33)12-14-28(20,2)24(22)13-15-29(23,25)3/h4-9,16,18,22,24-25,27H,10-15,17H2,1-3H3/b23-4-/t22-,24+,25+,27+,28+,29-/m1/s1

Standard InChI Key:  QGQGHSVMXNQHNS-UESWEDANSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    3.6155   -5.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6155   -6.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3249   -6.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3249   -4.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0343   -5.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0308   -6.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7370   -6.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4470   -6.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7439   -4.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4505   -5.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4674   -3.5962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7492   -3.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1781   -4.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1648   -4.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9434   -5.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4396   -4.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9650   -3.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2554   -4.4612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7250   -5.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5103   -4.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5235   -4.0689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7464   -3.8039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2342   -2.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6932   -2.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1731   -3.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1566   -5.6584    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4426   -4.4203    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7368   -5.6419    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0270   -4.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9042   -6.4643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1673   -5.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0672   -6.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7238   -6.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4807   -6.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5772   -5.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9196   -5.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  2  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 16 18  1  1
 17 23  2  0
 23 24  1  0
 13 25  1  1
 14 26  1  6
 10 27  1  1
  9 28  1  6
  5 29  1  1
  2 30  2  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 20 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4082032

    ---

Associated Targets(non-human)

LLC-PK1 (2135 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.62Molecular Weight (Monoisotopic): 441.2780AlogP: 6.57#Rotatable Bonds: 2
Polar Surface Area: 47.78Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.26CX LogD: 6.26
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: 0.97

References

1. Lee D, Kim T, Kim KH, Ham J, Jang TS, Kang KS, Lee JW..  (2017)  Evaluation of guggulsterone derivatives as novel kidney cell protective agents against cisplatin-induced nephrotoxicity.,  27  (14): [PMID:28552338] [10.1016/j.bmcl.2017.05.033]

Source