N-methyl-4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)-N-((2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl)benzamide

ID: ALA4082125

PubChem CID: 137646931

Max Phase: Preclinical

Molecular Formula: C29H37N3O6

Molecular Weight: 523.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](N[C@H]1CCN(c2ccc(C(=O)N(C)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)cc2)C1)c1cccc2ccccc12

Standard InChI:  InChI=1S/C29H37N3O6/c1-18(23-9-5-7-19-6-3-4-8-24(19)23)30-21-14-15-32(16-21)22-12-10-20(11-13-22)28(37)31(2)29(38)27(36)26(35)25(34)17-33/h3-13,18,21,25-27,29-30,33-36,38H,14-17H2,1-2H3/t18-,21+,25+,26-,27-,29+/m1/s1

Standard InChI Key:  LSXPGLOVELZLJZ-PJLSDSMISA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   33.5455   -6.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6808   -5.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6791   -6.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1046   -5.9409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3922   -5.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1090   -6.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3937   -7.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3913   -8.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1073   -8.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8237   -8.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8208   -7.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5353   -6.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2498   -7.1821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5336   -5.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9639   -6.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7188   -7.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2703   -6.4889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8567   -5.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0518   -5.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0879   -6.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4202   -7.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2408   -7.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7251   -6.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3842   -5.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5651   -5.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8832   -7.5783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3973   -8.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0255   -6.1575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7377   -9.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2518   -9.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5921  -10.4209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1062  -11.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4466  -11.8402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7010   -7.6642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5796   -8.1636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5554   -9.0832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4340   -9.5870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4099  -10.5066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  6  2  0
 11 12  1  0
 12 13  1  0
 12 14  1  1
 15 13  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23  1  1  0
  1 26  1  0
 26 27  1  0
  1 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 26 34  1  0
 27 35  1  6
 29 36  1  6
 30 37  1  1
 31 38  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4082125

    ---

Associated Targets(Human)

CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.63Molecular Weight (Monoisotopic): 523.2682AlogP: 1.23#Rotatable Bonds: 10
Polar Surface Area: 136.73Molecular Species: BASEHBA: 8HBD: 6
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.17CX Basic pKa: 9.45CX LogP: 1.15CX LogD: -0.88
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -0.66

References

1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG..  (2017)  Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration.,  27  (20): [PMID:28916340] [10.1016/j.bmcl.2017.09.008]

Source