The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-Amino-N-(3-(7-(3-acrylamido-4-methylphenylamino)-1-methyl-2-oxo-1,2 dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-3-(1H-indol-2-yl)propanamide ID: ALA4082327
PubChem CID: 137648133
Max Phase: Preclinical
Molecular Formula: C35H35N9O3
Molecular Weight: 629.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)[C@@H](N)Cc4cc5ccccc5[nH]4)ccc2C)C3)ccc1C
Standard InChI: InChI=1S/C35H35N9O3/c1-5-31(45)41-29-16-24(12-10-20(29)2)40-34-37-18-23-19-44(35(47)43(4)32(23)42-34)30-17-25(13-11-21(30)3)39-33(46)27(36)15-26-14-22-8-6-7-9-28(22)38-26/h5-14,16-18,27,38H,1,15,19,36H2,2-4H3,(H,39,46)(H,41,45)(H,37,40,42)/t27-/m0/s1
Standard InChI Key: JOIOMODRMBDYMI-MHZLTWQESA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
27.3645 -1.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3633 -2.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0805 -2.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7994 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7965 -1.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0787 -0.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6475 -0.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6462 -2.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5168 -2.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2331 -2.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9465 -2.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2319 -1.2299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9333 -2.0541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9297 -3.7074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6510 -3.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2175 -3.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2261 -2.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5168 -2.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7985 -2.4519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7937 -3.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5036 -3.6961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9262 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3680 -3.7096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0747 -3.6915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0703 -4.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3484 -4.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3435 -5.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0588 -6.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7802 -5.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7814 -4.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0554 -6.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4964 -6.1696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2140 -5.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9259 -6.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2155 -4.9282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9157 -6.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9478 -3.2904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6586 -2.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3719 -2.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4549 -3.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1188 -2.1278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6706 -2.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2595 -3.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6675 -4.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4864 -4.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8956 -3.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4852 -2.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
8 13 1 0
8 15 1 0
13 17 1 0
16 14 1 0
14 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 1 0
15 23 2 0
20 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
29 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
11 37 1 6
11 38 1 0
38 39 1 0
39 40 2 0
40 43 1 0
42 41 1 0
41 39 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.73Molecular Weight (Monoisotopic): 629.2863AlogP: 5.53#Rotatable Bonds: 9Polar Surface Area: 161.37Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 4CX Acidic pKa: 12.94CX Basic pKa: 8.07CX LogP: 4.74CX LogD: 3.99Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.13Np Likeness Score: -1.02
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]