(S)-2-Amino-N-(3-(7-(3-acrylamido-4-methylphenylamino)-1-methyl-2-oxo-1,2 dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-3-(1H-indol-2-yl)propanamide

ID: ALA4082327

PubChem CID: 137648133

Max Phase: Preclinical

Molecular Formula: C35H35N9O3

Molecular Weight: 629.73

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)[C@@H](N)Cc4cc5ccccc5[nH]4)ccc2C)C3)ccc1C

Standard InChI:  InChI=1S/C35H35N9O3/c1-5-31(45)41-29-16-24(12-10-20(29)2)40-34-37-18-23-19-44(35(47)43(4)32(23)42-34)30-17-25(13-11-21(30)3)39-33(46)27(36)15-26-14-22-8-6-7-9-28(22)38-26/h5-14,16-18,27,38H,1,15,19,36H2,2-4H3,(H,39,46)(H,41,45)(H,37,40,42)/t27-/m0/s1

Standard InChI Key:  JOIOMODRMBDYMI-MHZLTWQESA-N

Molfile:  

     RDKit          2D

 47 52  0  0  0  0  0  0  0  0999 V2000
   27.3645   -1.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3633   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0805   -2.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7994   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7965   -1.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0787   -0.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6475   -0.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6462   -2.4707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5168   -2.4696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2331   -2.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9465   -2.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2319   -1.2299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9333   -2.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9297   -3.7074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6510   -3.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2175   -3.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2261   -2.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5168   -2.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7985   -2.4519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7937   -3.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5036   -3.6961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9262   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3680   -3.7096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0747   -3.6915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0703   -4.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3484   -4.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3435   -5.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0588   -6.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7802   -5.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7814   -4.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0554   -6.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4964   -6.1696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2140   -5.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9259   -6.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2155   -4.9282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9157   -6.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9478   -3.2904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6586   -2.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3719   -2.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4549   -3.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1188   -2.1278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6706   -2.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2595   -3.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6675   -4.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4864   -4.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8956   -3.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4852   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  2  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
  8 13  1  0
  8 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  1  0
 15 23  2  0
 20 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  2  0
 11 37  1  6
 11 38  1  0
 38 39  1  0
 39 40  2  0
 40 43  1  0
 42 41  1  0
 41 39  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4082327

    ---

Associated Targets(Human)

BMX Tchem Tyrosine-protein kinase BMX (1995 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BaF3 (4657 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 629.73Molecular Weight (Monoisotopic): 629.2863AlogP: 5.53#Rotatable Bonds: 9
Polar Surface Area: 161.37Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 4
CX Acidic pKa: 12.94CX Basic pKa: 8.07CX LogP: 4.74CX LogD: 3.99
Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.13Np Likeness Score: -1.02

References

1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J..  (2017)  Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor.,  60  (5): [PMID:28140585] [10.1021/acs.jmedchem.6b01413]

Source