The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-fluoro-3-(4-methyl-2-morpholino-pyrimidin-5-yl)phenyl]methyl N-carbamimidoylcarbamate (2R,3R)-tartrate ID: ALA4082470
PubChem CID: 146029982
Max Phase: Preclinical
Molecular Formula: C22H27FN6O9
Molecular Weight: 388.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(N2CCOCC2)ncc1-c1cccc(COC(=O)NC(=N)N)c1F.O=C(O)[C@H](O)[C@@H](O)C(=O)O
Standard InChI: InChI=1S/C18H21FN6O3.C4H6O6/c1-11-14(9-22-17(23-11)25-5-7-27-8-6-25)13-4-2-3-12(15(13)19)10-28-18(26)24-16(20)21;5-1(3(7)8)2(6)4(9)10/h2-4,9H,5-8,10H2,1H3,(H4,20,21,24,26);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
Standard InChI Key: SVZQVNHQXRKSAJ-LREBCSMRSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
9.7306 -12.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4455 -11.7027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1604 -13.7707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4455 -12.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1604 -12.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8794 -12.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7306 -13.7707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0117 -12.5308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8794 -11.7027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5942 -12.9426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3479 -9.4288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6330 -9.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9224 -9.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2075 -9.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4927 -9.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4927 -8.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2075 -8.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9224 -8.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3523 -10.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3523 -9.8407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0672 -9.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7819 -9.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7819 -10.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0672 -11.0765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6416 -11.0765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6416 -11.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9267 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2119 -11.9002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2119 -11.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9267 -10.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0610 -9.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7749 -9.4300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0603 -10.6651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4879 -9.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2018 -9.4312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4872 -10.6663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2075 -10.6646 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4953 -11.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
4 2 1 6
4 5 1 0
5 3 1 6
5 6 1 0
1 7 2 0
1 8 1 0
6 9 2 0
6 10 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
11 12 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
25 30 1 0
19 25 1 0
15 22 1 0
11 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 2 0
14 37 1 0
23 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.40Molecular Weight (Monoisotopic): 388.1659AlogP: 1.55#Rotatable Bonds: 4Polar Surface Area: 126.45Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.46CX Basic pKa: 7.84CX LogP: 1.60CX LogD: 1.03Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -1.33
References 1. Yamaki S, Yamada H, Nagashima A, Kondo M, Shimada Y, Kadono K, Yoshihara K.. (2017) Synthesis and structure activity relationships of carbamimidoylcarbamate derivatives as novel vascular adhesion protein-1 inhibitors., 25 (21): [PMID:28988626 ] [10.1016/j.bmc.2017.09.036 ]