N,N'-(3,3'-(Piperazine-1,4-diyl)bis(3-oxopropane-3,1-diyl))bis(4-chlorobenzene-sulfonamide)

ID: ALA4082513

PubChem CID: 137648850

Max Phase: Preclinical

Molecular Formula: C22H26Cl2N4O6S2

Molecular Weight: 577.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCNS(=O)(=O)c1ccc(Cl)cc1)N1CCN(C(=O)CCNS(=O)(=O)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C22H26Cl2N4O6S2/c23-17-1-5-19(6-2-17)35(31,32)25-11-9-21(29)27-13-15-28(16-14-27)22(30)10-12-26-36(33,34)20-7-3-18(24)4-8-20/h1-8,25-26H,9-16H2

Standard InChI Key:  ZNIOZOCIRAYPFY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   29.0309  -11.1848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6265  -10.4790    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.2175  -11.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7282   -8.1389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1409   -8.8488    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.5493   -8.1364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6820   -9.2491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6820  -10.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3873  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0926  -10.0663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0926   -9.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3873   -8.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7997  -10.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7985  -11.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5080  -10.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2151  -10.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9234  -10.0704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9731   -8.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9707   -8.0254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2666   -9.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5577   -8.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8512   -9.2574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4358   -9.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3388  -10.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7266   -8.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0220   -9.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0265  -10.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7415  -10.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4432  -10.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0436  -10.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7555  -10.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7601   -9.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0468   -8.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3378   -9.2579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3219  -10.4976    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.4693   -8.8572    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
  7 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22  5  1  0
 17  2  1  0
  5 23  1  0
  2 24  1  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 24 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 24  1  0
 27 35  1  0
 32 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4082513

    ---

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 577.51Molecular Weight (Monoisotopic): 576.0671AlogP: 1.70#Rotatable Bonds: 10
Polar Surface Area: 132.96Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.33CX Basic pKa: CX LogP: 1.18CX LogD: 1.18
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.10

References

1. Bassetto M, Leyssen P, Neyts J, Yerukhimovich MM, Frick DN, Courtney-Smith M, Brancale A..  (2017)  In silico identification, design and synthesis of novel piperazine-based antiviral agents targeting the hepatitis C virus helicase.,  125  [PMID:27810598] [10.1016/j.ejmech.2016.10.043]

Source