The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(3,3'-(Piperazine-1,4-diyl)bis(3-oxopropane-3,1-diyl))bis(4-chlorobenzene-sulfonamide) ID: ALA4082513
PubChem CID: 137648850
Max Phase: Preclinical
Molecular Formula: C22H26Cl2N4O6S2
Molecular Weight: 577.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCNS(=O)(=O)c1ccc(Cl)cc1)N1CCN(C(=O)CCNS(=O)(=O)c2ccc(Cl)cc2)CC1
Standard InChI: InChI=1S/C22H26Cl2N4O6S2/c23-17-1-5-19(6-2-17)35(31,32)25-11-9-21(29)27-13-15-28(16-14-27)22(30)10-12-26-36(33,34)20-7-3-18(24)4-8-20/h1-8,25-26H,9-16H2
Standard InChI Key: ZNIOZOCIRAYPFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
29.0309 -11.1848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6265 -10.4790 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.2175 -11.1822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7282 -8.1389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1409 -8.8488 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.5493 -8.1364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6820 -9.2491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6820 -10.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3873 -10.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0926 -10.0663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0926 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3873 -8.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7997 -10.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7985 -11.2931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5080 -10.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2151 -10.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9234 -10.0704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9731 -8.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9707 -8.0254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2666 -9.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5577 -8.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8512 -9.2574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4358 -9.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3388 -10.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7266 -8.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0220 -9.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0265 -10.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7415 -10.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4432 -10.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0436 -10.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7555 -10.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7601 -9.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0468 -8.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3378 -9.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3219 -10.4976 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.4693 -8.8572 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
7 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 5 1 0
17 2 1 0
5 23 1 0
2 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
24 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 24 1 0
27 35 1 0
32 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.51Molecular Weight (Monoisotopic): 576.0671AlogP: 1.70#Rotatable Bonds: 10Polar Surface Area: 132.96Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.33CX Basic pKa: ┄CX LogP: 1.18CX LogD: 1.18Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.10
References 1. Bassetto M, Leyssen P, Neyts J, Yerukhimovich MM, Frick DN, Courtney-Smith M, Brancale A.. (2017) In silico identification, design and synthesis of novel piperazine-based antiviral agents targeting the hepatitis C virus helicase., 125 [PMID:27810598 ] [10.1016/j.ejmech.2016.10.043 ]