Euphoboetirane M

ID: ALA4082579

PubChem CID: 137647915

Max Phase: Preclinical

Molecular Formula: C27H33BrO5

Molecular Weight: 517.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(O)C[C@H](C)[C@H](O)[C@@H]3[C@H]1OC(=O)c1cccc(Br)c1)C2(C)C

Standard InChI:  InChI=1S/C27H33BrO5/c1-14-9-10-19-20(26(19,4)5)11-15(2)24(30)27(32)13-16(3)22(29)21(27)23(14)33-25(31)17-7-6-8-18(28)12-17/h6-8,11-12,16,19-23,29,32H,1,9-10,13H2,2-5H3/b15-11+/t16-,19-,20+,21+,22-,23-,27+/m0/s1

Standard InChI Key:  IRYDLTXWOIGMCT-ORUQBICOSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   26.6825   -3.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2497   -1.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8452   -1.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6622   -1.8691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8662   -1.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8663   -3.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6858   -1.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2832   -3.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2870   -2.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5049   -1.9632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0177   -2.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4988   -3.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2609   -2.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2646   -3.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0446   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0386   -1.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5206   -2.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9999   -0.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5534   -0.8871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3363   -2.6208    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.0321   -1.1474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.2006   -2.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2428   -4.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0647   -3.8301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.5577   -4.3728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8707   -1.5106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0587   -5.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7501   -5.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8683   -4.9073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9934   -4.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9401   -5.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6315   -6.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1327   -7.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9461   -7.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2510   -6.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8218   -6.7497    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  9  5  1  0
  8  6  1  0
  6  1  1  0
  1 14  1  0
 13  7  2  0
  7  5  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 14 15  1  0
 15 17  1  0
 16 13  1  0
 17 16  1  0
  3 17  1  0
 16  3  1  0
  7 18  1  0
  5 19  2  0
 17 20  1  6
 16 21  1  6
 11 22  1  1
 12 23  1  1
  8 24  1  6
  6 25  1  6
  9 26  1  1
 25 27  1  0
 27 28  1  0
 27 29  2  0
  1 30  2  0
 28 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 28  1  0
 32 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4082579

    ---

Associated Targets(non-human)

Saccharomyces cerevisiae (19171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.46Molecular Weight (Monoisotopic): 516.1511AlogP: 4.86#Rotatable Bonds: 2
Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.64CX Basic pKa: CX LogP: 5.60CX LogD: 5.60
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: 2.37

References

1. Mónico A, Nim S, Duarte N, Rawal MK, Prasad R, Di Pietro A, Ferreira MU..  (2017)  Lathyrol and epoxylathyrol derivatives: Modulation of Cdr1p and Mdr1p drug-efflux transporters of Candida albicans in Saccharomyces cerevisiae model.,  25  (13): [PMID:28479022] [10.1016/j.bmc.2017.04.016]

Source