(1S,3aS,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-10-chloro-1-isopropyl-5a,5b,8,8,11a-pentamethyl-9-oxo-2,3,3a,4,5,5a,5b,6,7,7a,8,9,11a,11b,12,13,13a,13b-octadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid

ID: ALA4082627

PubChem CID: 101346077

Max Phase: Preclinical

Molecular Formula: C30H45ClO3

Molecular Weight: 489.14

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)C=C(Cl)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12

Standard InChI:  InChI=1S/C30H45ClO3/c1-17(2)18-10-13-30(25(33)34)15-14-28(6)19(23(18)30)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h16-19,21-23H,8-15H2,1-7H3,(H,33,34)/t18-,19+,21-,22+,23+,27-,28+,29+,30-/m0/s1

Standard InChI Key:  YLBMPGPOVSIENS-DICHFOODSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    3.9580   -7.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5535   -6.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1446   -7.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8519   -5.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8519   -6.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5572   -5.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2625   -5.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2590   -6.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9611   -6.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6711   -6.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9680   -5.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6707   -5.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6874   -3.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9733   -4.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3901   -4.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3764   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0702   -5.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7821   -5.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0976   -3.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7937   -4.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4051   -3.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0868   -2.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2788   -3.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4980   -4.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2056   -4.2343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4982   -5.4603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7415   -2.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0062   -1.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9396   -2.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3683   -5.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2510   -7.0534    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2552   -4.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6626   -4.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3848   -3.3967    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1448   -6.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9609   -5.8318    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906   -4.6349    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1430   -5.0167    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  2  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 15 19  1  0
 16 17  1  0
 17 18  1  0
 18 20  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 24 25  1  0
 24 26  2  0
 23 27  1  6
 27 28  1  0
 27 29  1  0
 16 30  1  6
  8 31  1  6
  7 32  1  1
 12 33  1  1
 15 34  1  1
  5 35  2  0
 11 36  1  6
 19 37  1  6
  4 38  1  0
M  END

Associated Targets(Human)

SK-MEL-2 (46422 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.14Molecular Weight (Monoisotopic): 488.3057AlogP: 7.72#Rotatable Bonds: 2
Polar Surface Area: 54.37Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.79CX Basic pKa: CX LogP: 7.94CX LogD: 5.37
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: 2.57

References

1. Gupta N, Rath SK, Singh J, Qayum A, Singh S, Sangwan PL..  (2017)  Synthesis of novel benzylidene analogues of betulinic acid as potent cytotoxic agents.,  135  [PMID:28500966] [10.1016/j.ejmech.2017.04.062]

Source