The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-Oxo-3-[(E)-2-piperazin-1-yl-ethoxyimino]-7'-trifluoromethyl-1,3,1',2'-tetrahydro-[2,3']biindolylidene-5-carboxylic acid ID: ALA4082833
PubChem CID: 137646961
Max Phase: Preclinical
Molecular Formula: C24H22F3N5O4
Molecular Weight: 501.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1Nc2c(cccc2C(F)(F)F)/C1=C1/Nc2ccc(C(=O)O)cc2/C1=N\OCCN1CCNCC1
Standard InChI: InChI=1S/C24H22F3N5O4/c25-24(26,27)16-3-1-2-14-18(22(33)30-19(14)16)21-20(31-36-11-10-32-8-6-28-7-9-32)15-12-13(23(34)35)4-5-17(15)29-21/h1-5,12,28-29H,6-11H2,(H,30,33)(H,34,35)/b21-18-,31-20+
Standard InChI Key: YOYMCHALZIJQRO-OBYLKTCKSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
24.7867 -15.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7856 -16.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4936 -17.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4918 -15.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2004 -15.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2007 -16.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9837 -17.0131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4674 -16.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9833 -15.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2355 -14.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2846 -16.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7635 -17.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5406 -16.7550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7630 -15.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5440 -15.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1520 -15.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9802 -14.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1950 -14.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5904 -14.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5105 -17.7849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9295 -15.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0789 -15.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0787 -14.7137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3713 -15.9397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5360 -15.0938 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.1006 -16.4406 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.7178 -15.8486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.6885 -14.2968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9408 -13.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3938 -12.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6461 -12.1351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4502 -11.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7032 -11.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1591 -10.5894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3585 -10.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1019 -11.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
8 11 2 0
11 12 1 0
12 13 1 0
13 15 1 0
14 11 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 2 0
16 21 1 0
1 22 1 0
22 23 2 0
22 24 1 0
21 25 1 0
21 26 1 0
21 27 1 0
10 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.47Molecular Weight (Monoisotopic): 501.1624AlogP: 2.82#Rotatable Bonds: 5Polar Surface Area: 115.29Molecular Species: ZWITTERIONHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.57CX Basic pKa: 9.16CX LogP: -0.28CX LogD: -0.29Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.51
References 1. Gaboriaud-Kolar N, Myrianthopoulos V, Vougogiannopoulou K, Gerolymatos P, Horne DA, Jove R, Mikros E, Nam S, Skaltsounis AL.. (2016) Natural-Based Indirubins Display Potent Cytotoxicity toward Wild-Type and T315I-Resistant Leukemia Cell Lines., 79 (10): [PMID:27726390 ] [10.1021/acs.jnatprod.6b00285 ]