2'-Oxo-3-[(E)-2-piperazin-1-yl-ethoxyimino]-7'-trifluoromethyl-1,3,1',2'-tetrahydro-[2,3']biindolylidene-5-carboxylic acid

ID: ALA4082833

PubChem CID: 137646961

Max Phase: Preclinical

Molecular Formula: C24H22F3N5O4

Molecular Weight: 501.47

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C1Nc2c(cccc2C(F)(F)F)/C1=C1/Nc2ccc(C(=O)O)cc2/C1=N\OCCN1CCNCC1

Standard InChI:  InChI=1S/C24H22F3N5O4/c25-24(26,27)16-3-1-2-14-18(22(33)30-19(14)16)21-20(31-36-11-10-32-8-6-28-7-9-32)15-12-13(23(34)35)4-5-17(15)29-21/h1-5,12,28-29H,6-11H2,(H,30,33)(H,34,35)/b21-18-,31-20+

Standard InChI Key:  YOYMCHALZIJQRO-OBYLKTCKSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   24.7867  -15.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7856  -16.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4936  -17.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4918  -15.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2004  -15.9357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2007  -16.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9837  -17.0131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4674  -16.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9833  -15.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2355  -14.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2846  -16.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7635  -17.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5406  -16.7550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7630  -15.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5440  -15.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1520  -15.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9802  -14.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1950  -14.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5904  -14.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5105  -17.7849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9295  -15.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0789  -15.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0787  -14.7137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3713  -15.9397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5360  -15.0938    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.1006  -16.4406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.7178  -15.8486    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.6885  -14.2968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9408  -13.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3938  -12.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6461  -12.1351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4502  -11.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7032  -11.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1591  -10.5894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3585  -10.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1019  -11.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  8 11  2  0
 11 12  1  0
 12 13  1  0
 13 15  1  0
 14 11  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 12 20  2  0
 16 21  1  0
  1 22  1  0
 22 23  2  0
 22 24  1  0
 21 25  1  0
 21 26  1  0
 21 27  1  0
 10 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4082833

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 501.47

Molecular Weight (Monoisotopic): 501.1624

AlogP: 2.82

#Rotatable Bonds: 5

Polar Surface Area: 115.29

Molecular Species: ZWITTERION

HBA: 7

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.57

CX Basic pKa: 9.16

CX LogP: -0.28

CX LogD: -0.29

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.28

Np Likeness Score: -0.51

References

1. Gaboriaud-Kolar N, Myrianthopoulos V, Vougogiannopoulou K, Gerolymatos P, Horne DA, Jove R, Mikros E, Nam S, Skaltsounis AL..  (2016)  Natural-Based Indirubins Display Potent Cytotoxicity toward Wild-Type and T315I-Resistant Leukemia Cell Lines.,  79  (10): [PMID:27726390] [10.1021/acs.jnatprod.6b00285]

Source

Source(1):

• Scientific Literature