N-[2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-[4-(trifluoromethoxy)phenoxy]pyridine-3-carboxamide

ID: ALA4082836

PubChem CID: 137646963

Max Phase: Preclinical

Molecular Formula: C25H24BF3N2O5

Molecular Weight: 500.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)OB(c2ccccc2NC(=O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)nc2)OC1(C)C

Standard InChI:  InChI=1S/C25H24BF3N2O5/c1-23(2)24(3,4)36-26(35-23)19-7-5-6-8-20(19)31-22(32)16-9-14-21(30-15-16)33-17-10-12-18(13-11-17)34-25(27,28)29/h5-15H,1-4H3,(H,31,32)

Standard InChI Key:  KHEPBWVZKOHFEI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   15.3245  -14.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3287  -14.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6122  -14.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8579  -14.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1453  -14.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1443  -14.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6892  -13.1759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9690  -12.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9767  -11.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2636  -11.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5469  -11.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5434  -12.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2544  -13.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8240  -11.5051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5657  -11.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8488  -11.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8431  -12.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1246  -13.1853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4077  -12.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4169  -11.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1354  -11.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5672  -10.7139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2749  -11.9549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9955  -11.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7082  -11.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4288  -11.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4345  -10.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7196  -10.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9991  -10.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3856  -13.2502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7011  -12.7833    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   15.0460  -13.2936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8249  -10.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1109  -10.2668    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5399  -10.2684    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8206   -9.8539    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
  7  8  1  0
 11 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 15 22  2  0
 15 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 30 31  1  0
 31 32  1  0
 32  2  1  0
  2  5  1  0
 30  5  1  0
 25 31  1  0
 23 24  1  0
 19  7  1  0
 14 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4082836

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.28Molecular Weight (Monoisotopic): 500.1730AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ogiyama T, Yamaguchi M, Kurikawa N, Honzumi S, Yamamoto Y, Sugiyama D, Takakusa H, Inoue SI..  (2017)  Identification of a novel hormone sensitive lipase inhibitor with a reduced potential of reactive metabolites formation.,  25  (7): [PMID:28279560] [10.1016/j.bmc.2017.02.045]

Source