The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(3-fluoro-2-hydroxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentylamino)isoquinolin-1(2H)-one ID: ALA4082878
PubChem CID: 87733533
Max Phase: Preclinical
Molecular Formula: C22H22F4N2O3
Molecular Weight: 438.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(CC(O)(CNc1cccc2c(=O)[nH]ccc12)C(F)(F)F)c1cccc(F)c1O
Standard InChI: InChI=1S/C22H22F4N2O3/c1-20(2,15-6-4-7-16(23)18(15)29)11-21(31,22(24,25)26)12-28-17-8-3-5-14-13(17)9-10-27-19(14)30/h3-10,28-29,31H,11-12H2,1-2H3,(H,27,30)
Standard InChI Key: ZANAAVXGSNLYBQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
3.6485 -14.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0612 -14.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4696 -14.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9425 -15.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9414 -16.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6494 -16.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3591 -16.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3562 -15.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6476 -14.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6452 -13.9662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7716 -15.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4778 -14.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1871 -15.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8932 -14.7668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6025 -15.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6027 -15.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3111 -16.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0182 -15.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3035 -14.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0106 -15.1634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7107 -14.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7048 -13.9390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9930 -13.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2959 -13.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4747 -13.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1809 -13.5437 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.7655 -13.5490 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4686 -13.1370 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4727 -15.5885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2347 -14.7839 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4213 -15.1558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
8 2 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 20 1 0
19 15 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 19 1 0
12 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
12 29 1 0
4 30 1 0
21 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.42Molecular Weight (Monoisotopic): 438.1567AlogP: 4.45#Rotatable Bonds: 6Polar Surface Area: 85.35Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.08CX Basic pKa: 2.83CX LogP: 3.93CX LogD: 3.92Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.67
References 1. Berger M, Rehwinkel H, Schmees N, Schäcke H, Edman K, Wissler L, Reichel A, Jaroch S.. (2017) Discovery of new selective glucocorticoid receptor agonist leads., 27 (3): [PMID:28043796 ] [10.1016/j.bmcl.2016.12.047 ]