The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-(3-(3,4-Dimethyl-7-oxo-2-(p-tolyl)-2H-pyrazolo[3,4-d]pyridazin-6(7H)-yl)propyl)piperidin-4-yl)-2-(2-fluorophenyl)-2,3-dihydroquinazolin-4(1H)-one ID: ALA4082888
PubChem CID: 137645561
Max Phase: Preclinical
Molecular Formula: C36H38FN7O2
Molecular Weight: 619.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc3c(=O)n(CCCN4CCC(N5C(=O)c6ccccc6NC5c5ccccc5F)CC4)nc(C)c3c2C)cc1
Standard InChI: InChI=1S/C36H38FN7O2/c1-23-13-15-27(16-14-23)44-25(3)32-24(2)39-42(36(46)33(32)40-44)20-8-19-41-21-17-26(18-22-41)43-34(28-9-4-6-11-30(28)37)38-31-12-7-5-10-29(31)35(43)45/h4-7,9-16,26,34,38H,8,17-22H2,1-3H3
Standard InChI Key: OXOLNDYXTYKMCE-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 52 0 0 0 0 0 0 0 0999 V2000
7.3584 -4.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0637 -4.1520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0637 -3.3348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3584 -2.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6531 -4.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6486 -3.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8701 -3.0866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3933 -3.7504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8773 -4.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5782 -3.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1663 -3.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3499 -3.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9444 -3.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3613 -4.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1764 -4.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7726 -2.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4791 -3.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1880 -2.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8945 -3.3431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8871 -4.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5896 -4.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3009 -4.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3052 -3.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5983 -2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0058 -4.5820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9974 -5.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6982 -5.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7132 -4.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4185 -4.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4098 -5.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1101 -5.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8196 -5.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8244 -4.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1235 -4.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2878 -5.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5838 -5.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8727 -5.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8643 -6.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5729 -7.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2812 -6.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3584 -5.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3595 -2.1049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1272 -3.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7188 -3.3591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9861 -7.0291 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6291 -5.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 5 2 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
3 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
25 28 1 0
26 27 1 0
27 30 1 0
29 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
26 35 1 0
1 41 1 0
4 42 2 0
13 43 1 0
28 44 2 0
40 45 1 0
9 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 619.75Molecular Weight (Monoisotopic): 619.3071AlogP: 5.77#Rotatable Bonds: 7Polar Surface Area: 88.29Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.31CX Basic pKa: 8.28CX LogP: 5.57CX LogD: 4.64Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.25Np Likeness Score: -1.58
References 1. Jiang Y, Zhuang C, Chen L, Lu J, Dong G, Miao Z, Zhang W, Li J, Sheng C.. (2017) Structural Biology-Inspired Discovery of Novel KRAS-PDEδ Inhibitors., 60 (22): [PMID:28929751 ] [10.1021/acs.jmedchem.7b01243 ]