Diethyl trans-{5-[(3-(3-fluorobenzyl)-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl]-2-methylisoxazolidin-3-yl}phosphonate

ID: ALA4083282

PubChem CID: 137647717

Max Phase: Preclinical

Molecular Formula: C24H29FN3O6P

Molecular Weight: 505.48

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=O)(OCC)[C@@H]1C[C@@H](Cn2c(=O)n(Cc3cccc(F)c3)c(=O)c3ccccc32)ON1C

Standard InChI:  InChI=1S/C24H29FN3O6P/c1-4-32-35(31,33-5-2)22-14-19(34-26(22)3)16-27-21-12-7-6-11-20(21)23(29)28(24(27)30)15-17-9-8-10-18(25)13-17/h6-13,19,22H,4-5,14-16H2,1-3H3/t19-,22+/m0/s1

Standard InChI Key:  GLLIJKZBLPWGIT-SIKLNZKXSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    5.1338  -19.9717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8391  -19.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8391  -18.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1338  -18.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4285  -19.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4311  -18.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7273  -18.3437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0205  -18.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0220  -19.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7263  -19.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1324  -17.5201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5462  -19.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1338  -20.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4261  -21.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6772  -20.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1303  -21.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5390  -22.1790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3382  -22.0090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5480  -18.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2545  -18.7541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2505  -19.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9562  -19.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6661  -19.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6658  -18.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9596  -18.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3176  -21.3859    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.9852  -20.6393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8373  -22.0470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7198  -22.0889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3085  -22.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7143  -23.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0246  -21.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5442  -22.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3733  -18.3460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2066  -22.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  4 11  2  0
  2 12  2  0
  1 13  1  0
 14 13  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
  3 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 16 26  1  6
 26 27  2  0
 26 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
 24 34  1  0
 17 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4083282

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 505.48

Molecular Weight (Monoisotopic): 505.1778

AlogP: 3.58

#Rotatable Bonds: 9

Polar Surface Area: 92.00

Molecular Species: NEUTRAL

HBA: 9

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.26

CX LogD: 3.26

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.41

Np Likeness Score: -0.95

References

1. Piotrowska DG, Andrei G, Schols D, Snoeck R, Łysakowska M..  (2017)  Synthesis, anti-varicella-zoster virus and anti-cytomegalovirus activity of quinazoline-2,4-diones containing isoxazolidine and phosphonate substructures.,  126  [PMID:27750154] [10.1016/j.ejmech.2016.10.002]

Source

Source(1):

• Scientific Literature