The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(5-((2,4-Dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl)-2-fluoropyridin-3-yl)-1-(3,3,3-trifluoropropyl)pyrrolidine-3-carboxamide ID: ALA4083291
PubChem CID: 137648174
Max Phase: Preclinical
Molecular Formula: C22H21F4N5O3
Molecular Weight: 479.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(Cn2c(=O)[nH]c(=O)c3ccccc32)cnc1F)[C@H]1CCN(CCC(F)(F)F)C1
Standard InChI: InChI=1S/C22H21F4N5O3/c23-18-16(28-19(32)14-5-7-30(12-14)8-6-22(24,25)26)9-13(10-27-18)11-31-17-4-2-1-3-15(17)20(33)29-21(31)34/h1-4,9-10,14H,5-8,11-12H2,(H,28,32)(H,29,33,34)/t14-/m0/s1
Standard InChI Key: LLBQUOHKCAYWBR-AWEZNQCLSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
17.6810 -14.9612 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.1032 -14.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8917 -15.1727 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.9826 -14.8076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4170 -15.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6805 -15.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7914 -14.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5967 -14.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9624 -15.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9393 -16.2508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2673 -15.0034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7929 -14.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5262 -16.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5492 -15.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8541 -14.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1319 -15.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1089 -16.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8081 -16.5960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2212 -16.6409 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4368 -14.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4599 -14.1094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1780 -13.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2051 -12.9026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5059 -12.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7878 -12.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0928 -12.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3747 -12.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3516 -13.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0467 -14.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7648 -13.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5331 -11.6552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8772 -14.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2937 -14.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6042 -13.7379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
4 8 1 0
9 10 2 0
9 11 1 0
6 9 1 1
4 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
13 19 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
21 30 1 0
25 30 2 0
24 31 2 0
22 32 2 0
20 21 1 0
16 20 1 0
11 14 1 0
12 33 1 0
33 2 1 0
2 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.43Molecular Weight (Monoisotopic): 479.1581AlogP: 2.49#Rotatable Bonds: 6Polar Surface Area: 100.09Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.62CX Basic pKa: 8.18CX LogP: 2.01CX LogD: 1.31Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.64
References 1. Zhao H, Ji M, Cui G, Zhou J, Lai F, Chen X, Xu B.. (2017) Discovery of novel quinazoline-2,4(1H,3H)-dione derivatives as potent PARP-2 selective inhibitors., 25 (15): [PMID:28622906 ] [10.1016/j.bmc.2017.05.052 ]