The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(1-(4-Chlorobenzyl)pyrrolidin-3-yl)-2-(3-methoxyphenyl)-N-methylquinoline-4-carboxamide ID: ALA4083340
PubChem CID: 129318961
Max Phase: Preclinical
Molecular Formula: C29H28ClN3O2
Molecular Weight: 486.02
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2cc(C(=O)N(C)[C@@H]3CCN(Cc4ccc(Cl)cc4)C3)c3ccccc3n2)c1
Standard InChI: InChI=1S/C29H28ClN3O2/c1-32(23-14-15-33(19-23)18-20-10-12-22(30)13-11-20)29(34)26-17-28(21-6-5-7-24(16-21)35-2)31-27-9-4-3-8-25(26)27/h3-13,16-17,23H,14-15,18-19H2,1-2H3/t23-/m1/s1
Standard InChI Key: UPCGOPZWVBKZPL-HSZRJFAPSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
33.9533 -12.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9521 -13.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6602 -13.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6584 -11.9522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3670 -12.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3678 -13.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0763 -13.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7846 -13.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7798 -12.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0707 -11.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2476 -11.9528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2487 -11.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5417 -10.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8331 -11.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8360 -11.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5435 -12.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6621 -14.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9553 -14.8169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3707 -14.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1298 -12.3676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4206 -11.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2467 -14.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9572 -15.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2996 -16.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5539 -16.8911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3712 -16.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6218 -16.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0751 -17.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2622 -17.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9312 -16.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1191 -16.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6395 -17.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9777 -18.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7888 -18.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8264 -17.2216 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
1 11 1 0
3 17 1 0
17 18 1 0
17 19 2 0
15 20 1 0
20 21 1 0
18 22 1 0
23 18 1 6
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
25 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.02Molecular Weight (Monoisotopic): 485.1870AlogP: 5.91#Rotatable Bonds: 6Polar Surface Area: 45.67Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.37CX LogP: 5.60CX LogD: 5.31Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -1.59
References 1. Yamada K, Levell J, Yoon T, Kohls D, Yowe D, Rigel DF, Imase H, Yuan J, Yasoshima K, DiPetrillo K, Monovich L, Xu L, Zhu M, Kato M, Jain M, Idamakanti N, Taslimi P, Kawanami T, Argikar UA, Kunjathoor V, Xie X, Yagi YI, Iwaki Y, Robinson Z, Park HM.. (2017) Optimization of Allosteric With-No-Lysine (WNK) Kinase Inhibitors and Efficacy in Rodent Hypertension Models., 60 (16): [PMID:28771350 ] [10.1021/acs.jmedchem.7b00708 ]